Difference between revisions of "CPD-4568"

From metabolic_network
Jump to navigation Jump to search
(Created page with "Category:gene == Gene SJ21564 == * transcription-direction: ** positive * right-end-position: ** 372873 * left-end-position: ** 368358 * centisome-position: ** 61.890495...")
(Created page with "Category:metabolite == Metabolite IMIDAZOLE-ACETOL-P == * common-name: ** imidazole acetol-phosphate * smiles: ** c1(nc=nc=1cc(cop([o-])(=o)[o-])=o) * inchi-key: ** ycffms...")
Line 1: Line 1:
−
[[Category:gene]]
+
[[Category:metabolite]]
−
== Gene SJ21564 ==
+
== Metabolite IMIDAZOLE-ACETOL-P ==
−
* transcription-direction:
+
* common-name:
−
** positive
+
** imidazole acetol-phosphate
−
* right-end-position:
+
* smiles:
−
** 372873
+
** c1(nc=nc=1cc(cop([o-])(=o)[o-])=o)
−
* left-end-position:
+
* inchi-key:
−
** 368358
+
** ycffmsolumramd-uhfffaoysa-l
−
* centisome-position:
+
* molecular-weight:
−
** 61.890495   
+
** 218.105
−
== Organism(s) associated with this gene  ==
+
== Reaction(s) known to consume the compound ==
−
* [[S.japonica_carotenoid_curated]]
+
* [[HISTAMINOTRANS-RXN]]
−
== Reaction(s) associated ==
+
== Reaction(s) known to produce the compound ==
−
* [[HYDROXYMETHYLGLUTARYL-COA-LYASE-RXN]]
+
* [[HISTAMINOTRANS-RXN]]
−
** Category: [[annotation]]
+
* [[IGPD]]
−
*** source: [[saccharina_japonica_genome]]; tool: [[pathwaytools]]; comment: n.a
+
* [[IMIDPHOSDEHYD-RXN]]
−
** Category: [[orthology]]
+
== Reaction(s) of unknown directionality ==
−
*** source: [[output_pantograph_arabidopsis_thaliana]]; tool: [[pantograph]]; comment: n.a
+
{{#set: common-name=imidazole acetol-phosphate}}
−
*** source: [[output_pantograph_ectocarpus_siliculosus]]; tool: [[pantograph]]; comment: n.a
+
{{#set: inchi-key=inchikey=ycffmsolumramd-uhfffaoysa-l}}
−
== Pathway(s) associated ==
+
{{#set: molecular-weight=218.105}}
−
* [[LEU-DEG2-PWY]]
 
−
** '''4''' reactions found over '''6''' reactions in the full pathway
 
−
* [[PWY66-367]]
 
−
** '''4''' reactions found over '''5''' reactions in the full pathway
 
−
* [[PWY-5074]]
 
−
** '''1''' reactions found over '''2''' reactions in the full pathway
 
−
{{#set: transcription-direction=positive}}
 
−
{{#set: right-end-position=372873}}
 
−
{{#set: left-end-position=368358}}
 
−
{{#set: centisome-position=61.890495    }}
 
−
{{#set: organism associated=S.japonica_carotenoid_curated}}
 
−
{{#set: nb reaction associated=1}}
 
−
{{#set: nb pathway associated=3}}
 

Revision as of 20:32, 18 December 2020

Metabolite IMIDAZOLE-ACETOL-P

  • common-name:
    • imidazole acetol-phosphate
  • smiles:
    • c1(nc=nc=1cc(cop([o-])(=o)[o-])=o)
  • inchi-key:
    • ycffmsolumramd-uhfffaoysa-l
  • molecular-weight:
    • 218.105

Reaction(s) known to consume the compound

Reaction(s) known to produce the compound

Reaction(s) of unknown directionality

Retrieved from "https://gem-aureme.genouest.org/sjapgem/index.php?title=CPD-4568&oldid=46490"