Difference between revisions of "CPD-4577"
Jump to navigation
Jump to search
(Created page with "Category:metabolite == Metabolite CPD-12481 == * common-name: ** 7-methylurate * smiles: ** cn1(c(=o)nc2(=c1c(=o)nc(=o)n2)) * inchi-key: ** yhnnpkufpwltop-uhfffaoysa-n * m...") |
(Created page with "Category:metabolite == Metabolite Unspecified-Degradation-Products == * common-name: ** [unspecified degradation products] == Reaction(s) known to consume the compound ==...") |
||
Line 1: | Line 1: | ||
[[Category:metabolite]] | [[Category:metabolite]] | ||
− | == Metabolite | + | == Metabolite Unspecified-Degradation-Products == |
* common-name: | * common-name: | ||
− | ** | + | ** [unspecified degradation products] |
− | |||
− | |||
− | |||
− | |||
− | |||
− | |||
== Reaction(s) known to consume the compound == | == Reaction(s) known to consume the compound == | ||
== Reaction(s) known to produce the compound == | == Reaction(s) known to produce the compound == | ||
− | * [[RXN- | + | * [[2-NITROPROPANE-DIOXYGENASE-RXN]] |
+ | * [[RXN-16322]] | ||
== Reaction(s) of unknown directionality == | == Reaction(s) of unknown directionality == | ||
− | {{#set: common-name= | + | {{#set: common-name=[unspecified degradation products]}} |
− | |||
− |
Revision as of 11:17, 15 January 2021
Contents
Metabolite Unspecified-Degradation-Products
- common-name:
- [unspecified degradation products]