Difference between revisions of "CPD-4577"

From metabolic_network
Jump to navigation Jump to search
(Created page with "Category:metabolite == Metabolite 3-OXOPIMELOYL-COA == * common-name: ** 3-oxopimeloyl-coa * smiles: ** cc(c)(c(o)c(=o)nccc(=o)nccsc(cc(cccc([o-])=o)=o)=o)cop(=o)(op(=o)(o...")
(Created page with "Category:metabolite == Metabolite CPD-4577 == * common-name: ** 4α-carboxy-4β-methyl-5α-cholesta-8,24-dien-3β-ol * smiles: ** cc(c)=cccc(c)[ch]3(cc[c...")
 
(5 intermediate revisions by 2 users not shown)
Line 1: Line 1:
 
[[Category:metabolite]]
 
[[Category:metabolite]]
== Metabolite 3-OXOPIMELOYL-COA ==
+
== Metabolite CPD-4577 ==
 
* common-name:
 
* common-name:
** 3-oxopimeloyl-coa
+
** 4α-carboxy-4β-methyl-5α-cholesta-8,24-dien-3β-ol
 
* smiles:
 
* smiles:
** cc(c)(c(o)c(=o)nccc(=o)nccsc(cc(cccc([o-])=o)=o)=o)cop(=o)(op(=o)(occ1(c(op([o-])(=o)[o-])c(o)c(o1)n3(c2(=c(c(n)=nc=n2)n=c3))))[o-])[o-]
+
** cc(c)=cccc(c)[ch]3(cc[ch]4(c2(cc[ch]1(c(c([o-])=o)(c)c(o)ccc(c)1c=2ccc(c)34))))
 
* inchi-key:
 
* inchi-key:
** kjxfofktzdjlmq-uyrkptjqsa-i
+
** mywaiwdqtchpth-ljaizbfvsa-m
 
* molecular-weight:
 
* molecular-weight:
** 918.632
+
** 441.673
 
== Reaction(s) known to consume the compound ==
 
== Reaction(s) known to consume the compound ==
* [[RXN-8032]]
+
* [[RXN66-313]]
 
== Reaction(s) known to produce the compound ==
 
== Reaction(s) known to produce the compound ==
* [[RXN-8032]]
+
* [[RXN-13712]]
 +
* [[RXN-13712-44-DIMETHYL-824-CHOLESTADIENOL/NADH/OXYGEN-MOLECULE/PROTON//CPD-4577/NAD/WATER.79.]]
 +
* [[RXN-13712-44-DIMETHYL-824-CHOLESTADIENOL/NADPH/OXYGEN-MOLECULE/PROTON//CPD-4577/NADP/WATER.81.]]
 
== Reaction(s) of unknown directionality ==
 
== Reaction(s) of unknown directionality ==
{{#set: common-name=3-oxopimeloyl-coa}}
+
{{#set: common-name=4α-carboxy-4β-methyl-5α-cholesta-8,24-dien-3β-ol}}
{{#set: inchi-key=inchikey=kjxfofktzdjlmq-uyrkptjqsa-i}}
+
{{#set: inchi-key=inchikey=mywaiwdqtchpth-ljaizbfvsa-m}}
{{#set: molecular-weight=918.632}}
+
{{#set: molecular-weight=441.673}}

Latest revision as of 11:15, 18 March 2021

Metabolite CPD-4577

  • common-name:
    • 4α-carboxy-4β-methyl-5α-cholesta-8,24-dien-3β-ol
  • smiles:
    • cc(c)=cccc(c)[ch]3(cc[ch]4(c2(cc[ch]1(c(c([o-])=o)(c)c(o)ccc(c)1c=2ccc(c)34))))
  • inchi-key:
    • mywaiwdqtchpth-ljaizbfvsa-m
  • molecular-weight:
    • 441.673

Reaction(s) known to consume the compound

Reaction(s) known to produce the compound

Reaction(s) of unknown directionality