|
|
| Line 1: |
Line 1: |
| − | [[Category:reaction]] | + | [[Category:metabolite]] |
| − | == Reaction [http://metacyc.org/META/NEW-IMAGE?object=GLUCONOLACT-RXN GLUCONOLACT-RXN] == | + | == Metabolite S-LACTOYL-GLUTATHIONE == |
| − | * direction:
| |
| − | ** left-to-right
| |
| | * common-name: | | * common-name: |
| − | ** gluconolactonase | + | ** (r)-s-lactoylglutathione |
| − | * ec-number: | + | * smiles: |
| − | ** [http://enzyme.expasy.org/EC/3.1.1.17 ec-3.1.1.17] | + | ** cc(o)c(=o)scc(c(ncc([o-])=o)=o)nc(=o)ccc([n+])c([o-])=o |
| − | == Reaction formula == | + | * inchi-key: |
| − | * 1 [[GLC-D-LACTONE]][c] '''+''' 1 [[WATER]][c] '''=>''' 1 [[GLUCONATE]][c] '''+''' 1 [[PROTON]][c]
| + | ** vdydcvuwiliyqf-csmhccousa-m |
| − | == Gene(s) associated with this reaction ==
| + | * molecular-weight: |
| − | * Gene: [[SJ05433]] | + | ** 378.376 |
| − | ** Category: [[annotation]] | + | == Reaction(s) known to consume the compound == |
| − | *** Source: [[saccharina_japonica_genome]], Tool: [[pathwaytools]], Assignment: ec-number, Comment: n.a
| + | * [[GLYOXI-RXN]] |
| − | * Gene: [[SJ19511]]
| + | * [[GLYOXII-RXN]] |
| − | ** Category: [[annotation]]
| + | == Reaction(s) known to produce the compound == |
| − | *** Source: [[saccharina_japonica_genome]], Tool: [[pathwaytools]], Assignment: ec-number, Comment: n.a | + | * [[GLYOXI-RXN]] |
| − | * Gene: [[SJ05432]]
| + | == Reaction(s) of unknown directionality == |
| − | ** Category: [[annotation]]
| + | {{#set: common-name=(r)-s-lactoylglutathione}} |
| − | *** Source: [[saccharina_japonica_genome]], Tool: [[pathwaytools]], Assignment: ec-number, Comment: n.a
| + | {{#set: inchi-key=inchikey=vdydcvuwiliyqf-csmhccousa-m}} |
| − | == Pathway(s) == | + | {{#set: molecular-weight=378.376}} |
| − | * [[GLUCOSE1PMETAB-PWY]], glucose and glucose-1-phosphate degradation: [http://metacyc.org/META/NEW-IMAGE?object=GLUCOSE1PMETAB-PWY GLUCOSE1PMETAB-PWY] | |
| − | ** '''3''' reactions found over '''5''' reactions in the full pathway
| |
| − | * [[DHGLUCONATE-PYR-CAT-PWY]], glucose degradation (oxidative): [http://metacyc.org/META/NEW-IMAGE?object=DHGLUCONATE-PYR-CAT-PWY DHGLUCONATE-PYR-CAT-PWY] | |
| − | ** '''1''' reactions found over '''5''' reactions in the full pathway
| |
| − | * [[PWY-2221]], Entner-Doudoroff pathway III (semi-phosphorylative): [http://metacyc.org/META/NEW-IMAGE?object=PWY-2221 PWY-2221]
| |
| − | ** '''6''' reactions found over '''9''' reactions in the full pathway
| |
| − | * [[NPGLUCAT-PWY]], Entner-Doudoroff pathway II (non-phosphorylative): [http://metacyc.org/META/NEW-IMAGE?object=NPGLUCAT-PWY NPGLUCAT-PWY]
| |
| − | ** '''4''' reactions found over '''9''' reactions in the full pathway
| |
| − | * [[PWY-5530]], sorbitol biosynthesis II: [http://metacyc.org/META/NEW-IMAGE?object=PWY-5530 PWY-5530]
| |
| − | ** '''2''' reactions found over '''3''' reactions in the full pathway
| |
| − | * [[PWY-7165]], L-ascorbate biosynthesis VI (engineered pathway): [http://metacyc.org/META/NEW-IMAGE?object=PWY-7165 PWY-7165]
| |
| − | ** '''1''' reactions found over '''7''' reactions in the full pathway
| |
| − | == Reconstruction information ==
| |
| − | * category: [[annotation]]; source: [[saccharina_japonica_genome]]; tool: [[pathwaytools]]; comment: n.a | |
| − | == External links == | |
| − | * RHEA:
| |
| − | ** [http://www.ebi.ac.uk/rhea/reaction.xhtml?id=10441 10441]
| |
| − | * LIGAND-RXN:
| |
| − | ** [http://www.genome.jp/dbget-bin/www_bget?R01519 R01519]
| |
| − | * UNIPROT:
| |
| − | ** [http://www.uniprot.org/uniprot/Q01578 Q01578]
| |
| − | {{#set: direction=left-to-right}}
| |
| − | {{#set: common-name=gluconolactonase}} | |
| − | {{#set: ec-number=ec-3.1.1.17}}
| |
| − | {{#set: nb gene associated=3}} | |
| − | {{#set: nb pathway associated=6}}
| |
| − | {{#set: reconstruction category=annotation}} | |
| − | {{#set: reconstruction tool=pathwaytools}}
| |
| − | {{#set: reconstruction comment=n.a}}
| |
| − | {{#set: reconstruction source=saccharina_japonica_genome}}
| |
