Difference between revisions of "CPD-4578"

From metabolic_network
Jump to navigation Jump to search
(Created page with "Category:metabolite == Metabolite CPD-19163 == * common-name: ** (2e,11z)-octadecenoyl-coa * smiles: ** ccccccc=ccccccccc=cc(=o)sccnc(=o)ccnc(=o)c(o)c(c)(c)cop(=o)(op(=o)(...")
(Created page with "Category:metabolite == Metabolite 5-CarboxyMeAmMe-2-O-MeU34-tRNALeu == * common-name: ** a 5-carboxymethylaminomethyl-2'-o-methyluridine34 in trnaleu == Reaction(s) known...")
Line 1: Line 1:
 
[[Category:metabolite]]
 
[[Category:metabolite]]
== Metabolite CPD-19163 ==
+
== Metabolite 5-CarboxyMeAmMe-2-O-MeU34-tRNALeu ==
 
* common-name:
 
* common-name:
** (2e,11z)-octadecenoyl-coa
+
** a 5-carboxymethylaminomethyl-2'-o-methyluridine34 in trnaleu
* smiles:
 
** ccccccc=ccccccccc=cc(=o)sccnc(=o)ccnc(=o)c(o)c(c)(c)cop(=o)(op(=o)(occ1(c(op([o-])(=o)[o-])c(o)c(o1)n3(c2(=c(c(n)=nc=n2)n=c3))))[o-])[o-]
 
* inchi-key:
 
** opmpwwfmnywbgf-pkybcsrxsa-j
 
* molecular-weight:
 
** 1025.937
 
 
== Reaction(s) known to consume the compound ==
 
== Reaction(s) known to consume the compound ==
* [[RXN-17785]]
 
 
== Reaction(s) known to produce the compound ==
 
== Reaction(s) known to produce the compound ==
* [[RXN-17784]]
+
* [[RXN-11865]]
 
== Reaction(s) of unknown directionality ==
 
== Reaction(s) of unknown directionality ==
{{#set: common-name=(2e,11z)-octadecenoyl-coa}}
+
{{#set: common-name=a 5-carboxymethylaminomethyl-2'-o-methyluridine34 in trnaleu}}
{{#set: inchi-key=inchikey=opmpwwfmnywbgf-pkybcsrxsa-j}}
 
{{#set: molecular-weight=1025.937}}
 

Revision as of 15:29, 5 January 2021

Metabolite 5-CarboxyMeAmMe-2-O-MeU34-tRNALeu

  • common-name:
    • a 5-carboxymethylaminomethyl-2'-o-methyluridine34 in trnaleu

Reaction(s) known to consume the compound

Reaction(s) known to produce the compound

Reaction(s) of unknown directionality