Difference between revisions of "CPD-4578"
Jump to navigation
Jump to search
(Created page with "Category:reaction == Reaction [http://metacyc.org/META/NEW-IMAGE?object=IRON--CYTOCHROME-C-REDUCTASE-RXN IRON--CYTOCHROME-C-REDUCTASE-RXN] == * direction: ** reversible *...") |
(Created page with "Category:metabolite == Metabolite 1-O-SINAPOYL-BETA-D-GLUCOSE == * common-name: ** 1-o-sinapoyl-β-d-glucose * smiles: ** coc2(=cc(c=cc(=o)oc1(c(o)c(c(c(o1)co)o)o))=cc...") |
||
| Line 1: | Line 1: | ||
| − | [[Category: | + | [[Category:metabolite]] |
| − | == | + | == Metabolite 1-O-SINAPOYL-BETA-D-GLUCOSE == |
| − | |||
| − | |||
* common-name: | * common-name: | ||
| − | ** | + | ** 1-o-sinapoyl-β-d-glucose |
| − | * | + | * smiles: |
| − | ** | + | ** coc2(=cc(c=cc(=o)oc1(c(o)c(c(c(o1)co)o)o))=cc(=c(o)2)oc) |
| − | == | + | * inchi-key: |
| − | + | ** xrkbrpftfkkhef-dgdbgzaxsa-n | |
| − | == | + | * molecular-weight: |
| − | * | + | ** 386.355 |
| − | ** | + | == Reaction(s) known to consume the compound == |
| − | ** | + | * [[2.3.1.91-RXN]] |
| − | == | + | == Reaction(s) known to produce the compound == |
| − | + | == Reaction(s) of unknown directionality == | |
| − | * | + | {{#set: common-name=1-o-sinapoyl-β-d-glucose}} |
| − | == | + | {{#set: inchi-key=inchikey=xrkbrpftfkkhef-dgdbgzaxsa-n}} |
| − | + | {{#set: molecular-weight=386.355}} | |
| − | |||
| − | |||
| − | {{#set: common-name= | ||
| − | |||
| − | {{#set: | ||
| − | |||
| − | {{#set: | ||
| − | |||
| − | |||
| − | |||
Revision as of 20:35, 18 December 2020
Contents
Metabolite 1-O-SINAPOYL-BETA-D-GLUCOSE
- common-name:
- 1-o-sinapoyl-β-d-glucose
- smiles:
- coc2(=cc(c=cc(=o)oc1(c(o)c(c(c(o1)co)o)o))=cc(=c(o)2)oc)
- inchi-key:
- xrkbrpftfkkhef-dgdbgzaxsa-n
- molecular-weight:
- 386.355
