Difference between revisions of "CPD-458"
Jump to navigation
Jump to search
(Created page with "Category:metabolite == Metabolite DADP == * common-name: ** dadp * smiles: ** c(c3(c(cc(n2(c1(=c(c(=nc=n1)n)n=c2)))o3)o))op(op([o-])([o-])=o)([o-])=o * inchi-key: ** daeap...") |
(Created page with "Category:metabolite == Metabolite CPD-13293 == * common-name: ** β-d-fucose * smiles: ** cc1(c(o)c(o)c(o)c(o)o1) * inchi-key: ** shzgcjcmobcmkk-fprjbgldsa-n * molecul...") |
||
| Line 1: | Line 1: | ||
[[Category:metabolite]] | [[Category:metabolite]] | ||
| − | == Metabolite | + | == Metabolite CPD-13293 == |
* common-name: | * common-name: | ||
| − | ** | + | ** β-d-fucose |
* smiles: | * smiles: | ||
| − | ** | + | ** cc1(c(o)c(o)c(o)c(o)o1) |
* inchi-key: | * inchi-key: | ||
| − | ** | + | ** shzgcjcmobcmkk-fprjbgldsa-n |
* molecular-weight: | * molecular-weight: | ||
| − | ** | + | ** 164.158 |
== Reaction(s) known to consume the compound == | == Reaction(s) known to consume the compound == | ||
| − | |||
| − | |||
| − | |||
| − | |||
| − | |||
| − | |||
== Reaction(s) known to produce the compound == | == Reaction(s) known to produce the compound == | ||
| − | * [[ | + | * [[3.2.1.38-RXN]] |
| − | |||
| − | |||
| − | |||
| − | |||
| − | |||
| − | |||
| − | |||
| − | |||
== Reaction(s) of unknown directionality == | == Reaction(s) of unknown directionality == | ||
| − | {{#set: common-name= | + | {{#set: common-name=β-d-fucose}} |
| − | {{#set: inchi-key=inchikey= | + | {{#set: inchi-key=inchikey=shzgcjcmobcmkk-fprjbgldsa-n}} |
| − | {{#set: molecular-weight= | + | {{#set: molecular-weight=164.158}} |
Revision as of 08:26, 15 March 2021
Contents
Metabolite CPD-13293
- common-name:
- β-d-fucose
- smiles:
- cc1(c(o)c(o)c(o)c(o)o1)
- inchi-key:
- shzgcjcmobcmkk-fprjbgldsa-n
- molecular-weight:
- 164.158
