Difference between revisions of "CPD-458"

Latest revision as of 11:13, 18 March 2021

@@ Line 1: / Line 1: @@
 [[Category:metabolite]]
-== Metabolite DADP ==
+== Metabolite CPD-458 ==
 * common-name:
-** dadp
+** galactinol
 * smiles:
-** c(c3(c(cc(n2(c1(=c(c(=nc=n1)n)n=c2)))o3)o))op(op([o-])([o-])=o)([o-])=o
+** c(c1(oc(c(c(c1o)o)o)oc2(c(c(c(c(c2o)o)o)o)o)))o
 * inchi-key:
-** daeapnuqqaicnr-rrkcrqdmsa-k
+** vcwmrqdbpzkxkg-xidcdeprsa-n
 * molecular-weight:
-** 408.18
+** 342.299
 == Reaction(s) known to consume the compound ==
-* [[DADPKIN-RXN]]
+* [[2.4.1.67-RXN]]
-* [[DATPtm]]
+* [[2.4.1.82-RXN]]
-* [[NDPK]]
+* [[RXN-8281]]
-* [[NDPKm]]
-* [[RXN-14192]]
-* [[RXN-14215]]
 == Reaction(s) known to produce the compound ==
-* [[ADPREDUCT-RXN]]
+* [[2.4.1.123-RXN]]
-* [[ATDAM]]
+* [[2.4.1.67-RXN]]
-* [[DAOTO]]
-* [[DATCY]]
-* [[DATPtm]]
-* [[DATUP]]
-* [[DEOXYADENYLATE-KINASE-RXN]]
-* [[RXN-14214]]
-* [[RXN0-747]]
 == Reaction(s) of unknown directionality ==
-{{#set: common-name=dadp}}
+{{#set: common-name=galactinol}}
-{{#set: inchi-key=inchikey=daeapnuqqaicnr-rrkcrqdmsa-k}}
+{{#set: inchi-key=inchikey=vcwmrqdbpzkxkg-xidcdeprsa-n}}
-{{#set: molecular-weight=408.18}}
+{{#set: molecular-weight=342.299}}