Difference between revisions of "CPD-4617"
Jump to navigation
Jump to search
(Created page with "Category:metabolite == Metabolite CPD-13524 == * common-name: ** all-trans-retinol * smiles: ** cc(=cc=cc(c)=cco)c=cc1(=c(c)cccc(c)(c)1) * inchi-key: ** fpipgxgpppqfeq-ovs...") |
(Created page with "Category:metabolite == Metabolite 5-DIPHOSPHO-1D-MYO-INOSITOL-12346P == * common-name: ** 1d-myoinositol 5-diphosphate 1,2,3,4,6-pentakisphosphate * smiles: ** c1(op([o-])...") |
||
Line 1: | Line 1: | ||
[[Category:metabolite]] | [[Category:metabolite]] | ||
− | == Metabolite | + | == Metabolite 5-DIPHOSPHO-1D-MYO-INOSITOL-12346P == |
* common-name: | * common-name: | ||
− | ** | + | ** 1d-myoinositol 5-diphosphate 1,2,3,4,6-pentakisphosphate |
* smiles: | * smiles: | ||
− | ** | + | ** c1(op([o-])([o-])=o)(c(op([o-])([o-])=o)c(op([o-])(=o)[o-])c(op([o-])(=o)op([o-])(=o)[o-])c(op(=o)([o-])[o-])c(op(=o)([o-])[o-])1) |
* inchi-key: | * inchi-key: | ||
− | ** | + | ** uphpwxpnziozjl-kxxvrosksa-a |
* molecular-weight: | * molecular-weight: | ||
− | ** | + | ** 726.913 |
== Reaction(s) known to consume the compound == | == Reaction(s) known to consume the compound == | ||
− | * [[ | + | * [[2.7.4.24-RXN]] |
− | * [[ | + | * [[RXN-10964]] |
− | + | * [[RXN-10965]] | |
− | * [[RXN- | + | * [[RXN-10979]] |
− | * [[RXN- | ||
== Reaction(s) known to produce the compound == | == Reaction(s) known to produce the compound == | ||
− | * [[ | + | * [[2.7.1.152-RXN]] |
− | + | * [[RXN-10965]] | |
− | |||
− | |||
− | |||
− | * [[RXN- | ||
== Reaction(s) of unknown directionality == | == Reaction(s) of unknown directionality == | ||
− | {{#set: common-name= | + | {{#set: common-name=1d-myoinositol 5-diphosphate 1,2,3,4,6-pentakisphosphate}} |
− | {{#set: inchi-key=inchikey= | + | {{#set: inchi-key=inchikey=uphpwxpnziozjl-kxxvrosksa-a}} |
− | {{#set: molecular-weight= | + | {{#set: molecular-weight=726.913}} |
Revision as of 11:14, 15 January 2021
Contents
Metabolite 5-DIPHOSPHO-1D-MYO-INOSITOL-12346P
- common-name:
- 1d-myoinositol 5-diphosphate 1,2,3,4,6-pentakisphosphate
- smiles:
- c1(op([o-])([o-])=o)(c(op([o-])([o-])=o)c(op([o-])(=o)[o-])c(op([o-])(=o)op([o-])(=o)[o-])c(op(=o)([o-])[o-])c(op(=o)([o-])[o-])1)
- inchi-key:
- uphpwxpnziozjl-kxxvrosksa-a
- molecular-weight:
- 726.913