Difference between revisions of "CPD-4617"

From metabolic_network
Jump to navigation Jump to search
(Created page with "Category:metabolite == Metabolite CPD-19157 == * common-name: ** 3-oxo-(7z)-tetradecenoyl-coa * smiles: ** ccccccc=ccccc(=o)cc(=o)sccnc(=o)ccnc(=o)c(o)c(c)(c)cop(=o)(op(=o...")
(Created page with "Category:metabolite == Metabolite 2-D-THREO-HYDROXY-3-CARBOXY-ISOCAPROATE == * common-name: ** (2r,3s)-3-isopropylmalate * smiles: ** cc(c)c(c([o-])=o)c(c([o-])=o)o * inch...")
Line 1: Line 1:
 
[[Category:metabolite]]
 
[[Category:metabolite]]
== Metabolite CPD-19157 ==
+
== Metabolite 2-D-THREO-HYDROXY-3-CARBOXY-ISOCAPROATE ==
 
* common-name:
 
* common-name:
** 3-oxo-(7z)-tetradecenoyl-coa
+
** (2r,3s)-3-isopropylmalate
 
* smiles:
 
* smiles:
** ccccccc=ccccc(=o)cc(=o)sccnc(=o)ccnc(=o)c(o)c(c)(c)cop(=o)(op(=o)(occ1(c(op([o-])(=o)[o-])c(o)c(o1)n3(c2(=c(c(n)=nc=n2)n=c3))))[o-])[o-]
+
** cc(c)c(c([o-])=o)c(c([o-])=o)o
 
* inchi-key:
 
* inchi-key:
** bepllrgjvxaeji-twafkmgksa-j
+
** rnqhmtfbussbjq-crclsjgqsa-l
 
* molecular-weight:
 
* molecular-weight:
** 985.829
+
** 174.153
 
== Reaction(s) known to consume the compound ==
 
== Reaction(s) known to consume the compound ==
* [[RXN-17795]]
+
* [[3-ISOPROPYLMALDEHYDROG-RXN]]
 +
* [[IMDH]]
 +
* [[IMDHT_LPAREN_3c2hmp_RPAREN_]]
 +
* [[RXN-13158]]
 +
* [[RXN-13163]]
 +
* [[RXN-8991]]
 
== Reaction(s) known to produce the compound ==
 
== Reaction(s) known to produce the compound ==
* [[RXN-17794]]
+
* [[3-ISOPROPYLMALDEHYDROG-RXN]]
 +
* [[IMDHT_LPAREN_3c2hmp_RPAREN_]]
 +
* [[RXN-13163]]
 +
* [[RXN-8991]]
 
== Reaction(s) of unknown directionality ==
 
== Reaction(s) of unknown directionality ==
{{#set: common-name=3-oxo-(7z)-tetradecenoyl-coa}}
+
{{#set: common-name=(2r,3s)-3-isopropylmalate}}
{{#set: inchi-key=inchikey=bepllrgjvxaeji-twafkmgksa-j}}
+
{{#set: inchi-key=inchikey=rnqhmtfbussbjq-crclsjgqsa-l}}
{{#set: molecular-weight=985.829}}
+
{{#set: molecular-weight=174.153}}

Revision as of 15:26, 5 January 2021

Metabolite 2-D-THREO-HYDROXY-3-CARBOXY-ISOCAPROATE

  • common-name:
    • (2r,3s)-3-isopropylmalate
  • smiles:
    • cc(c)c(c([o-])=o)c(c([o-])=o)o
  • inchi-key:
    • rnqhmtfbussbjq-crclsjgqsa-l
  • molecular-weight:
    • 174.153

Reaction(s) known to consume the compound

Reaction(s) known to produce the compound

Reaction(s) of unknown directionality