Difference between revisions of "CPD-4617"
Jump to navigation
Jump to search
(Created page with "Category:metabolite == Metabolite 2-D-THREO-HYDROXY-3-CARBOXY-ISOCAPROATE == * common-name: ** (2r,3s)-3-isopropylmalate * smiles: ** cc(c)c(c([o-])=o)c(c([o-])=o)o * inch...") |
(Created page with "Category:metabolite == Metabolite CPD-13524 == * common-name: ** all-trans-retinol * smiles: ** cc(=cc=cc(c)=cco)c=cc1(=c(c)cccc(c)(c)1) * inchi-key: ** fpipgxgpppqfeq-ovs...") |
||
| Line 1: | Line 1: | ||
[[Category:metabolite]] | [[Category:metabolite]] | ||
| − | == Metabolite | + | == Metabolite CPD-13524 == |
* common-name: | * common-name: | ||
| − | ** | + | ** all-trans-retinol |
* smiles: | * smiles: | ||
| − | ** cc(c)c(c( | + | ** cc(=cc=cc(c)=cco)c=cc1(=c(c)cccc(c)(c)1) |
* inchi-key: | * inchi-key: | ||
| − | ** | + | ** fpipgxgpppqfeq-ovsjkpmpsa-n |
* molecular-weight: | * molecular-weight: | ||
| − | ** | + | ** 286.456 |
== Reaction(s) known to consume the compound == | == Reaction(s) known to consume the compound == | ||
| − | * [[3 | + | * [[1.3.99.23-RXN]] |
| − | * [[ | + | * [[RETINOL-DEHYDROGENASE-RXN]] |
| − | + | * [[RETINOL-O-FATTY-ACYLTRANSFERASE-RXN]] | |
| − | * [[RXN | + | * [[RXN-10841]] |
| − | * [[RXN- | + | * [[RXN-12547]] |
| − | * [[RXN- | ||
== Reaction(s) known to produce the compound == | == Reaction(s) known to produce the compound == | ||
| − | * [[3- | + | * [[3.1.1.64-RXN]] |
| − | * [[ | + | * [[RETINOL-DEHYDROGENASE-RXN]] |
| − | * [[RXN- | + | * [[RETINOL-O-FATTY-ACYLTRANSFERASE-RXN]] |
| − | * [[RXN- | + | * [[RXN-10841]] |
| + | * [[RXN-12575]] | ||
| + | * [[RXN-12579]] | ||
== Reaction(s) of unknown directionality == | == Reaction(s) of unknown directionality == | ||
| − | {{#set: common-name= | + | {{#set: common-name=all-trans-retinol}} |
| − | {{#set: inchi-key=inchikey= | + | {{#set: inchi-key=inchikey=fpipgxgpppqfeq-ovsjkpmpsa-n}} |
| − | {{#set: molecular-weight= | + | {{#set: molecular-weight=286.456}} |
Revision as of 18:54, 14 January 2021
Contents
Metabolite CPD-13524
- common-name:
- all-trans-retinol
- smiles:
- cc(=cc=cc(c)=cco)c=cc1(=c(c)cccc(c)(c)1)
- inchi-key:
- fpipgxgpppqfeq-ovsjkpmpsa-n
- molecular-weight:
- 286.456
Reaction(s) known to consume the compound
Reaction(s) known to produce the compound
- 3.1.1.64-RXN
- RETINOL-DEHYDROGENASE-RXN
- RETINOL-O-FATTY-ACYLTRANSFERASE-RXN
- RXN-10841
- RXN-12575
- RXN-12579
