Difference between revisions of "CPD-4618"
Jump to navigation
Jump to search
(Created page with "Category:metabolite == Metabolite PROTEIN-L-BETA-ISOSPARTATE-METHYL-ESTERS == * common-name: ** a protein l-β-isoaspartate α-methyl ester == Reaction(s) known t...") |
(Created page with "Category:metabolite == Metabolite CPD-13533 == * common-name: ** (3r)-3-hydroxypentanoyl-coa * smiles: ** ccc(cc(sccnc(ccnc(c(c(cop(=o)([o-])op(occ1(oc(c(c1op([o-])([o-])=...") |
||
| Line 1: | Line 1: | ||
[[Category:metabolite]] | [[Category:metabolite]] | ||
| − | == Metabolite | + | == Metabolite CPD-13533 == |
* common-name: | * common-name: | ||
| − | ** | + | ** (3r)-3-hydroxypentanoyl-coa |
| + | * smiles: | ||
| + | ** ccc(cc(sccnc(ccnc(c(c(cop(=o)([o-])op(occ1(oc(c(c1op([o-])([o-])=o)o)n3(c=nc2(c(=nc=nc=23)n))))([o-])=o)(c)c)o)=o)=o)=o)o | ||
| + | * inchi-key: | ||
| + | ** yygypcrwzmlsgk-orumcernsa-j | ||
| + | * molecular-weight: | ||
| + | ** 863.619 | ||
== Reaction(s) known to consume the compound == | == Reaction(s) known to consume the compound == | ||
| + | * [[RXN-12560]] | ||
== Reaction(s) known to produce the compound == | == Reaction(s) known to produce the compound == | ||
| − | |||
== Reaction(s) of unknown directionality == | == Reaction(s) of unknown directionality == | ||
| − | {{#set: common-name= | + | {{#set: common-name=(3r)-3-hydroxypentanoyl-coa}} |
| + | {{#set: inchi-key=inchikey=yygypcrwzmlsgk-orumcernsa-j}} | ||
| + | {{#set: molecular-weight=863.619}} | ||
Revision as of 08:28, 15 March 2021
Contents
Metabolite CPD-13533
- common-name:
- (3r)-3-hydroxypentanoyl-coa
- smiles:
- ccc(cc(sccnc(ccnc(c(c(cop(=o)([o-])op(occ1(oc(c(c1op([o-])([o-])=o)o)n3(c=nc2(c(=nc=nc=23)n))))([o-])=o)(c)c)o)=o)=o)=o)o
- inchi-key:
- yygypcrwzmlsgk-orumcernsa-j
- molecular-weight:
- 863.619
