Difference between revisions of "CPD-4618"

From metabolic_network
Jump to navigation Jump to search
(Created page with "Category:gene == Gene SJ01083 == * transcription-direction: ** negative * right-end-position: ** 43687 * left-end-position: ** 29076 * centisome-position: ** 18.686615...")
(Created page with "Category:metabolite == Metabolite CPD-4618 == * common-name: ** cis-zeatin-7-n-glucoside * smiles: ** cc(=ccnc1(c2(=c(n=cn=1)n=cn2c3(c(c(c(c(o3)co)o)o)o))))co * inchi-key:...")
 
(7 intermediate revisions by 3 users not shown)
Line 1: Line 1:
−
[[Category:gene]]
+
[[Category:metabolite]]
−
== Gene SJ01083 ==
+
== Metabolite CPD-4618 ==
−
* transcription-direction:
+
* common-name:
−
** negative
+
** cis-zeatin-7-n-glucoside
−
* right-end-position:
+
* smiles:
−
** 43687
+
** cc(=ccnc1(c2(=c(n=cn=1)n=cn2c3(c(c(c(c(o3)co)o)o)o))))co
−
* left-end-position:
+
* inchi-key:
−
** 29076
+
** htdhrclvwuexis-gihywfgssa-n
−
* centisome-position:
+
* molecular-weight:
−
** 18.686615   
+
** 381.388
−
== Organism(s) associated with this gene  ==
+
== Reaction(s) known to consume the compound ==
−
* [[S.japonica_carotenoid_curated]]
+
== Reaction(s) known to produce the compound ==
−
== Reaction(s) associated ==
+
* [[RXN-4733]]
−
* [[ANTHRANSYN-RXN]]
+
== Reaction(s) of unknown directionality ==
−
** Category: [[annotation]]
+
{{#set: common-name=cis-zeatin-7-n-glucoside}}
−
*** source: [[saccharina_japonica_genome]]; tool: [[pathwaytools]]; comment: n.a
+
{{#set: inchi-key=inchikey=htdhrclvwuexis-gihywfgssa-n}}
−
* [[IGPSYN-RXN]]
+
{{#set: molecular-weight=381.388}}
−
** Category: [[annotation]]
 
−
*** source: [[saccharina_japonica_genome]]; tool: [[pathwaytools]]; comment: n.a
 
−
** Category: [[orthology]]
 
−
*** source: [[output_pantograph_nannochloropsis_salina]]; tool: [[pantograph]]; comment: n.a
 
−
*** source: [[output_pantograph_ectocarpus_siliculosus]]; tool: [[pantograph]]; comment: n.a
 
−
* [[PRAISOM-RXN]]
 
−
** Category: [[annotation]]
 
−
*** source: [[saccharina_japonica_genome]]; tool: [[pathwaytools]]; comment: n.a
 
−
** Category: [[orthology]]
 
−
*** source: [[output_pantograph_nannochloropsis_salina]]; tool: [[pantograph]]; comment: n.a
 
−
*** source: [[output_pantograph_ectocarpus_siliculosus]]; tool: [[pantograph]]; comment: n.a
 
−
== Pathway(s) associated ==
 
−
* [[PWY-5958]]
 
−
** '''1''' reactions found over '''4''' reactions in the full pathway
 
−
* [[TRPSYN-PWY]]
 
−
** '''6''' reactions found over '''6''' reactions in the full pathway
 
−
* [[PWY-6661]]
 
−
** '''1''' reactions found over '''5''' reactions in the full pathway
 
−
* [[PWY-6660]]
 
−
** '''1''' reactions found over '''8''' reactions in the full pathway
 
−
{{#set: transcription-direction=negative}}
 
−
{{#set: right-end-position=43687}}
 
−
{{#set: left-end-position=29076}}
 
−
{{#set: centisome-position=18.686615    }}
 
−
{{#set: organism associated=S.japonica_carotenoid_curated}}
 
−
{{#set: nb reaction associated=3}}
 
−
{{#set: nb pathway associated=4}}
 

Latest revision as of 11:14, 18 March 2021

Metabolite CPD-4618

  • common-name:
    • cis-zeatin-7-n-glucoside
  • smiles:
    • cc(=ccnc1(c2(=c(n=cn=1)n=cn2c3(c(c(c(c(o3)co)o)o)o))))co
  • inchi-key:
    • htdhrclvwuexis-gihywfgssa-n
  • molecular-weight:
    • 381.388

Reaction(s) known to consume the compound

Reaction(s) known to produce the compound

Reaction(s) of unknown directionality

Retrieved from "https://gem-aureme.genouest.org/sjapgem/index.php?title=CPD-4618&oldid=138297"