Difference between revisions of "CPD-4618"
Jump to navigation
Jump to search
(Created page with "Category:gene == Gene SJ22385 == * transcription-direction: ** negative * right-end-position: ** 33452 * left-end-position: ** 30378 * centisome-position: ** 17.128069...") |
(Created page with "Category:metabolite == Metabolite CPD-4618 == * common-name: ** cis-zeatin-7-n-glucoside * smiles: ** cc(=ccnc1(c2(=c(n=cn=1)n=cn2c3(c(c(c(c(o3)co)o)o)o))))co * inchi-key:...") |
||
| (9 intermediate revisions by 5 users not shown) | |||
| Line 1: | Line 1: | ||
| − | [[Category: | + | [[Category:metabolite]] |
| − | == | + | == Metabolite CPD-4618 == |
| − | * | + | * common-name: |
| − | ** | + | ** cis-zeatin-7-n-glucoside |
| − | * | + | * smiles: |
| − | ** | + | ** cc(=ccnc1(c2(=c(n=cn=1)n=cn2c3(c(c(c(c(o3)co)o)o)o))))co |
| − | * | + | * inchi-key: |
| − | ** | + | ** htdhrclvwuexis-gihywfgssa-n |
| − | * | + | * molecular-weight: |
| − | ** | + | ** 381.388 |
| − | == | + | == Reaction(s) known to consume the compound == |
| − | + | == Reaction(s) known to produce the compound == | |
| − | == Reaction(s) | + | * [[RXN-4733]] |
| − | * [[ | + | == Reaction(s) of unknown directionality == |
| − | + | {{#set: common-name=cis-zeatin-7-n-glucoside}} | |
| − | + | {{#set: inchi-key=inchikey=htdhrclvwuexis-gihywfgssa-n}} | |
| − | + | {{#set: molecular-weight=381.388}} | |
| − | |||
| − | |||
| − | |||
| − | |||
| − | {{#set: | ||
| − | |||
| − | |||
| − | {{#set: | ||
| − | {{#set: | ||
| − | |||
Latest revision as of 11:14, 18 March 2021
Contents
Metabolite CPD-4618
- common-name:
- cis-zeatin-7-n-glucoside
- smiles:
- cc(=ccnc1(c2(=c(n=cn=1)n=cn2c3(c(c(c(c(o3)co)o)o)o))))co
- inchi-key:
- htdhrclvwuexis-gihywfgssa-n
- molecular-weight:
- 381.388
