Difference between revisions of "CPD-4618"
Jump to navigation
Jump to search
(Created page with "Category:metabolite == Metabolite Cyclic-3-5-Nucleoside-Monophosphates == * common-name: ** a nucleoside cyclic 3',5'-monophosphate == Reaction(s) known to consume the com...") |
(Created page with "Category:metabolite == Metabolite CPD-4618 == * common-name: ** cis-zeatin-7-n-glucoside * smiles: ** cc(=ccnc1(c2(=c(n=cn=1)n=cn2c3(c(c(c(c(o3)co)o)o)o))))co * inchi-key:...") |
||
| (3 intermediate revisions by 2 users not shown) | |||
| Line 1: | Line 1: | ||
[[Category:metabolite]] | [[Category:metabolite]] | ||
| − | == Metabolite | + | == Metabolite CPD-4618 == |
* common-name: | * common-name: | ||
| − | ** | + | ** cis-zeatin-7-n-glucoside |
| + | * smiles: | ||
| + | ** cc(=ccnc1(c2(=c(n=cn=1)n=cn2c3(c(c(c(c(o3)co)o)o)o))))co | ||
| + | * inchi-key: | ||
| + | ** htdhrclvwuexis-gihywfgssa-n | ||
| + | * molecular-weight: | ||
| + | ** 381.388 | ||
== Reaction(s) known to consume the compound == | == Reaction(s) known to consume the compound == | ||
| − | |||
== Reaction(s) known to produce the compound == | == Reaction(s) known to produce the compound == | ||
| + | * [[RXN-4733]] | ||
== Reaction(s) of unknown directionality == | == Reaction(s) of unknown directionality == | ||
| − | {{#set: common-name= | + | {{#set: common-name=cis-zeatin-7-n-glucoside}} |
| + | {{#set: inchi-key=inchikey=htdhrclvwuexis-gihywfgssa-n}} | ||
| + | {{#set: molecular-weight=381.388}} | ||
Latest revision as of 11:14, 18 March 2021
Contents
Metabolite CPD-4618
- common-name:
- cis-zeatin-7-n-glucoside
- smiles:
- cc(=ccnc1(c2(=c(n=cn=1)n=cn2c3(c(c(c(c(o3)co)o)o)o))))co
- inchi-key:
- htdhrclvwuexis-gihywfgssa-n
- molecular-weight:
- 381.388
