Difference between revisions of "CPD-4618"
Jump to navigation
Jump to search
(Created page with "Category:metabolite == Metabolite CYS-GLY == * common-name: ** l-cysteinyl-glycine * smiles: ** c(c([o-])=o)nc(c(cs)[n+])=o * inchi-key: ** zukpvrwzdmrieo-vkhmyheasa-n * m...") |
(Created page with "Category:metabolite == Metabolite Cyclic-3-5-Nucleoside-Monophosphates == * common-name: ** a nucleoside cyclic 3',5'-monophosphate == Reaction(s) known to consume the com...") |
||
| Line 1: | Line 1: | ||
[[Category:metabolite]] | [[Category:metabolite]] | ||
| − | == Metabolite | + | == Metabolite Cyclic-3-5-Nucleoside-Monophosphates == |
* common-name: | * common-name: | ||
| − | ** | + | ** a nucleoside cyclic 3',5'-monophosphate |
| − | |||
| − | |||
| − | |||
| − | |||
| − | |||
| − | |||
== Reaction(s) known to consume the compound == | == Reaction(s) known to consume the compound == | ||
| − | * [[RXN | + | * [[3.1.4.17-RXN]] |
== Reaction(s) known to produce the compound == | == Reaction(s) known to produce the compound == | ||
| − | |||
| − | |||
| − | |||
| − | |||
== Reaction(s) of unknown directionality == | == Reaction(s) of unknown directionality == | ||
| − | {{#set: common-name= | + | {{#set: common-name=a nucleoside cyclic 3',5'-monophosphate}} |
| − | |||
| − | |||
Revision as of 13:10, 14 January 2021
Contents
Metabolite Cyclic-3-5-Nucleoside-Monophosphates
- common-name:
- a nucleoside cyclic 3',5'-monophosphate
