Difference between revisions of "CPD-4702"

From metabolic_network
Jump to navigation Jump to search
(Created page with "Category:metabolite == Metabolite CPD-19160 == * common-name: ** 3-oxo-(11z)-octadecenoyl-coa * smiles: ** ccccccc=ccccccccc(=o)cc(=o)sccnc(=o)ccnc(=o)c(o)c(c)(c)cop(=o)(o...")
(Created page with "Category:metabolite == Metabolite CPD-4702 == * common-name: ** 4α-carboxy-5α-cholesta-8,24-dien-3β-ol * smiles: ** cc(c)=cccc(c)[ch]3(cc[ch]4(c2(cc[ch]1(...")
 
(6 intermediate revisions by 2 users not shown)
Line 1: Line 1:
 
[[Category:metabolite]]
 
[[Category:metabolite]]
== Metabolite CPD-19160 ==
+
== Metabolite CPD-4702 ==
 
* common-name:
 
* common-name:
** 3-oxo-(11z)-octadecenoyl-coa
+
** 4α-carboxy-5α-cholesta-8,24-dien-3β-ol
 
* smiles:
 
* smiles:
** ccccccc=ccccccccc(=o)cc(=o)sccnc(=o)ccnc(=o)c(o)c(c)(c)cop(=o)(op(=o)(occ1(c(op([o-])(=o)[o-])c(o)c(o1)n3(c2(=c(c(n)=nc=n2)n=c3))))[o-])[o-]
+
** cc(c)=cccc(c)[ch]3(cc[ch]4(c2(cc[ch]1(c(c([o-])=o)c(o)ccc(c)1c=2ccc(c)34))))
 
* inchi-key:
 
* inchi-key:
** ourowzutgfhrje-saiinbspsa-j
+
** jhiwifrqjxlneu-gsqagghasa-m
 
* molecular-weight:
 
* molecular-weight:
** 1041.936
+
** 427.646
 
== Reaction(s) known to consume the compound ==
 
== Reaction(s) known to consume the compound ==
* [[RXN-17787]]
+
* [[RXN66-318]]
 
== Reaction(s) known to produce the compound ==
 
== Reaction(s) known to produce the compound ==
* [[RXN-17786]]
+
* [[RXN-13709]]
 +
* [[RXN-13709-4-METHYL-824-CHOLESTADIENOL/NADH/OXYGEN-MOLECULE/PROTON//CPD-4702/NAD/WATER.76.]]
 +
* [[RXN-13709-4-METHYL-824-CHOLESTADIENOL/NADPH/OXYGEN-MOLECULE/PROTON//CPD-4702/NADP/WATER.78.]]
 
== Reaction(s) of unknown directionality ==
 
== Reaction(s) of unknown directionality ==
{{#set: common-name=3-oxo-(11z)-octadecenoyl-coa}}
+
{{#set: common-name=4α-carboxy-5α-cholesta-8,24-dien-3β-ol}}
{{#set: inchi-key=inchikey=ourowzutgfhrje-saiinbspsa-j}}
+
{{#set: inchi-key=inchikey=jhiwifrqjxlneu-gsqagghasa-m}}
{{#set: molecular-weight=1041.936}}
+
{{#set: molecular-weight=427.646}}

Latest revision as of 11:18, 18 March 2021

Metabolite CPD-4702

  • common-name:
    • 4α-carboxy-5α-cholesta-8,24-dien-3β-ol
  • smiles:
    • cc(c)=cccc(c)[ch]3(cc[ch]4(c2(cc[ch]1(c(c([o-])=o)c(o)ccc(c)1c=2ccc(c)34))))
  • inchi-key:
    • jhiwifrqjxlneu-gsqagghasa-m
  • molecular-weight:
    • 427.646

Reaction(s) known to consume the compound

Reaction(s) known to produce the compound

Reaction(s) of unknown directionality