Difference between revisions of "CPD-474"

From metabolic_network
Jump to navigation Jump to search
(Created page with "Category:gene == Gene SJ01689 == * transcription-direction: ** negative * right-end-position: ** 35512 * left-end-position: ** 28486 * centisome-position: ** 19.430178...")
(Created page with "Category:metabolite == Metabolite CPD-474 == * common-name: ** (+)-taxifolin * smiles: ** c1(c=c(o)c(o)=cc=1c2(oc3(c=c([o-])c=c(o)c(c(=o)c(o)2)=3))) * inchi-key: ** cxqwrc...")
 
(8 intermediate revisions by 4 users not shown)
Line 1: Line 1:
[[Category:gene]]
+
[[Category:metabolite]]
== Gene SJ01689 ==
+
== Metabolite CPD-474 ==
* transcription-direction:
+
* common-name:
** negative
+
** (+)-taxifolin
* right-end-position:
+
* smiles:
** 35512
+
** c1(c=c(o)c(o)=cc=1c2(oc3(c=c([o-])c=c(o)c(c(=o)c(o)2)=3)))
* left-end-position:
+
* inchi-key:
** 28486
+
** cxqwrcvtcmqvqx-lsdhhaiusa-m
* centisome-position:
+
* molecular-weight:
** 19.430178   
+
** 303.248
== Organism(s) associated with this gene  ==
+
== Reaction(s) known to consume the compound ==
* [[S.japonica_carotenoid_curated]]
+
* [[RXN-527]]
== Reaction(s) associated ==
+
* [[RXN-600]]
* [[AKBLIG-RXN]]
+
== Reaction(s) known to produce the compound ==
** Category: [[orthology]]
+
* [[RXN-7775]]
*** source: [[output_pantograph_nannochloropsis_salina]]; tool: [[pantograph]]; comment: n.a
+
== Reaction(s) of unknown directionality ==
* [[SERINE-C-PALMITOYLTRANSFERASE-RXN]]
+
{{#set: common-name=(+)-taxifolin}}
** Category: [[annotation]]
+
{{#set: inchi-key=inchikey=cxqwrcvtcmqvqx-lsdhhaiusa-m}}
*** source: [[saccharina_japonica_genome]]; tool: [[pathwaytools]]; comment: n.a
+
{{#set: molecular-weight=303.248}}
** Category: [[orthology]]
 
*** source: [[output_pantograph_nannochloropsis_salina]]; tool: [[pantograph]]; comment: n.a
 
== Pathway(s) associated ==
 
* [[THREONINE-DEG2-PWY]]
 
** '''2''' reactions found over '''2''' reactions in the full pathway
 
* [[PWY3DJ-12]]
 
** '''2''' reactions found over '''4''' reactions in the full pathway
 
* [[SPHINGOLIPID-SYN-PWY]]
 
** '''4''' reactions found over '''11''' reactions in the full pathway
 
* [[PWY-5129]]
 
** '''4''' reactions found over '''13''' reactions in the full pathway
 
{{#set: transcription-direction=negative}}
 
{{#set: right-end-position=35512}}
 
{{#set: left-end-position=28486}}
 
{{#set: centisome-position=19.430178    }}
 
{{#set: organism associated=S.japonica_carotenoid_curated}}
 
{{#set: nb reaction associated=2}}
 
{{#set: nb pathway associated=4}}
 

Latest revision as of 11:14, 18 March 2021

Metabolite CPD-474

  • common-name:
    • (+)-taxifolin
  • smiles:
    • c1(c=c(o)c(o)=cc=1c2(oc3(c=c([o-])c=c(o)c(c(=o)c(o)2)=3)))
  • inchi-key:
    • cxqwrcvtcmqvqx-lsdhhaiusa-m
  • molecular-weight:
    • 303.248

Reaction(s) known to consume the compound

Reaction(s) known to produce the compound

Reaction(s) of unknown directionality