Difference between revisions of "CPD-474"
Jump to navigation
Jump to search
(Created page with "Category:gene == Gene SJ01689 == * transcription-direction: ** negative * right-end-position: ** 35512 * left-end-position: ** 28486 * centisome-position: ** 19.430178...") |
(Created page with "Category:metabolite == Metabolite CPD-474 == * common-name: ** (+)-taxifolin * smiles: ** c1(c=c(o)c(o)=cc=1c2(oc3(c=c([o-])c=c(o)c(c(=o)c(o)2)=3))) * inchi-key: ** cxqwrc...") |
||
(8 intermediate revisions by 4 users not shown) | |||
Line 1: | Line 1: | ||
− | [[Category: | + | [[Category:metabolite]] |
− | == | + | == Metabolite CPD-474 == |
− | * | + | * common-name: |
− | ** | + | ** (+)-taxifolin |
− | + | * smiles: | |
− | + | ** c1(c=c(o)c(o)=cc=1c2(oc3(c=c([o-])c=c(o)c(c(=o)c(o)2)=3))) | |
− | * | + | * inchi-key: |
− | ** | + | ** cxqwrcvtcmqvqx-lsdhhaiusa-m |
− | + | * molecular-weight: | |
− | + | ** 303.248 | |
− | = | + | == Reaction(s) known to consume the compound == |
− | + | * [[RXN-527]] | |
− | == | + | * [[RXN-600]] |
− | * | + | == Reaction(s) known to produce the compound == |
− | + | * [[RXN-7775]] | |
− | ** | + | == Reaction(s) of unknown directionality == |
− | + | {{#set: common-name=(+)-taxifolin}} | |
− | * | + | {{#set: inchi-key=inchikey=cxqwrcvtcmqvqx-lsdhhaiusa-m}} |
− | ** | + | {{#set: molecular-weight=303.248}} |
− | |||
− | |||
− | == | ||
− | * [[ | ||
− | |||
− | * [[ | ||
− | |||
− | * [[ | ||
− | |||
− | |||
− | |||
− | {{#set: | ||
− | {{#set: | ||
− | |||
− | {{#set: | ||
− | |||
− | |||
− |
Latest revision as of 11:14, 18 March 2021
Contents
Metabolite CPD-474
- common-name:
- (+)-taxifolin
- smiles:
- c1(c=c(o)c(o)=cc=1c2(oc3(c=c([o-])c=c(o)c(c(=o)c(o)2)=3)))
- inchi-key:
- cxqwrcvtcmqvqx-lsdhhaiusa-m
- molecular-weight:
- 303.248