Difference between revisions of "CPD-482"

From metabolic_network
Jump to navigation Jump to search
(Created page with "Category:metabolite == Metabolite CPD-17045 == * common-name: ** 3-benzyl-3,6-dihydroxy-6-(hydroxymethyl)-diketopiperazine * smiles: ** c(o)c2(o)(nc(=o)c(o)(cc1(=cc=cc=c1)...")
(Created page with "Category:metabolite == Metabolite 3-hydroxy-L-asparagine-HIF-Alpha == * common-name: ** a (3s)-3-hydroxy-l-asparagine-hif α subunit == Reaction(s) known to consume t...")
Line 1: Line 1:
 
[[Category:metabolite]]
 
[[Category:metabolite]]
== Metabolite CPD-17045 ==
+
== Metabolite 3-hydroxy-L-asparagine-HIF-Alpha ==
 
* common-name:
 
* common-name:
** 3-benzyl-3,6-dihydroxy-6-(hydroxymethyl)-diketopiperazine
+
** a (3s)-3-hydroxy-l-asparagine-hif α subunit
* smiles:
 
** c(o)c2(o)(nc(=o)c(o)(cc1(=cc=cc=c1))nc(=o)2)
 
* inchi-key:
 
** pxypzmrmtkvysm-vxgbxaggsa-n
 
* molecular-weight:
 
** 266.253
 
 
== Reaction(s) known to consume the compound ==
 
== Reaction(s) known to consume the compound ==
* [[RXN-15680]]
 
 
== Reaction(s) known to produce the compound ==
 
== Reaction(s) known to produce the compound ==
 +
* [[RXN-11321]]
 
== Reaction(s) of unknown directionality ==
 
== Reaction(s) of unknown directionality ==
{{#set: common-name=3-benzyl-3,6-dihydroxy-6-(hydroxymethyl)-diketopiperazine}}
+
{{#set: common-name=a (3s)-3-hydroxy-l-asparagine-hif α subunit}}
{{#set: inchi-key=inchikey=pxypzmrmtkvysm-vxgbxaggsa-n}}
 
{{#set: molecular-weight=266.253}}
 

Revision as of 08:30, 15 March 2021

Metabolite 3-hydroxy-L-asparagine-HIF-Alpha

  • common-name:
    • a (3s)-3-hydroxy-l-asparagine-hif α subunit

Reaction(s) known to consume the compound

Reaction(s) known to produce the compound

Reaction(s) of unknown directionality