Difference between revisions of "CPD-4821"
Jump to navigation
Jump to search
(Created page with "Category:metabolite == Metabolite PHE == * common-name: ** l-phenylalanine * smiles: ** c([o-])(=o)c([n+])cc1(c=cc=cc=1) * inchi-key: ** colnvldhvkwlrt-qmmmgpobsa-n * mole...") |
(Created page with "Category:metabolite == Metabolite CPD-4821 == * common-name: ** kanamycin a * smiles: ** c([n+])c1(c(o)c(o)c(o)c(o1)oc2(c([n+])cc(c(c2o)oc3(oc(co)c(o)c([n+])c(o)3))[n+]))...") |
||
| (One intermediate revision by the same user not shown) | |||
| Line 1: | Line 1: | ||
[[Category:metabolite]] | [[Category:metabolite]] | ||
| − | == Metabolite | + | == Metabolite CPD-4821 == |
* common-name: | * common-name: | ||
| − | ** | + | ** kanamycin a |
* smiles: | * smiles: | ||
| − | ** c([o | + | ** c([n+])c1(c(o)c(o)c(o)c(o1)oc2(c([n+])cc(c(c2o)oc3(oc(co)c(o)c([n+])c(o)3))[n+])) |
* inchi-key: | * inchi-key: | ||
| − | ** | + | ** sbujhosqtjfqjx-noamyhissa-r |
* molecular-weight: | * molecular-weight: | ||
| − | ** | + | ** 488.534 |
== Reaction(s) known to consume the compound == | == Reaction(s) known to consume the compound == | ||
| − | * [[ | + | * [[RXN-13167]] |
| − | + | * [[RXN-15285]] | |
| − | |||
| − | |||
| − | * [[RXN- | ||
| − | |||
== Reaction(s) known to produce the compound == | == Reaction(s) known to produce the compound == | ||
| − | |||
| − | |||
| − | |||
== Reaction(s) of unknown directionality == | == Reaction(s) of unknown directionality == | ||
| − | {{#set: common-name= | + | {{#set: common-name=kanamycin a}} |
| − | {{#set: inchi-key=inchikey= | + | {{#set: inchi-key=inchikey=sbujhosqtjfqjx-noamyhissa-r}} |
| − | {{#set: molecular-weight= | + | {{#set: molecular-weight=488.534}} |
Latest revision as of 11:14, 18 March 2021
Contents
Metabolite CPD-4821
- common-name:
- kanamycin a
- smiles:
- c([n+])c1(c(o)c(o)c(o)c(o1)oc2(c([n+])cc(c(c2o)oc3(oc(co)c(o)c([n+])c(o)3))[n+]))
- inchi-key:
- sbujhosqtjfqjx-noamyhissa-r
- molecular-weight:
- 488.534
