Difference between revisions of "CPD-4821"
Jump to navigation
Jump to search
(Created page with "Category:metabolite == Metabolite CPD-15317 == * common-name: ** d-ribofuranose 5-phosphate == Reaction(s) known to consume the compound == * RXN0-5398 == Reaction(s)...") |
(Created page with "Category:metabolite == Metabolite CPD-4821 == * common-name: ** kanamycin a * smiles: ** c([n+])c1(c(o)c(o)c(o)c(o1)oc2(c([n+])cc(c(c2o)oc3(oc(co)c(o)c([n+])c(o)3))[n+]))...") |
||
| (5 intermediate revisions by 3 users not shown) | |||
| Line 1: | Line 1: | ||
[[Category:metabolite]] | [[Category:metabolite]] | ||
| − | == Metabolite CPD- | + | == Metabolite CPD-4821 == |
* common-name: | * common-name: | ||
| − | ** | + | ** kanamycin a |
| + | * smiles: | ||
| + | ** c([n+])c1(c(o)c(o)c(o)c(o1)oc2(c([n+])cc(c(c2o)oc3(oc(co)c(o)c([n+])c(o)3))[n+])) | ||
| + | * inchi-key: | ||
| + | ** sbujhosqtjfqjx-noamyhissa-r | ||
| + | * molecular-weight: | ||
| + | ** 488.534 | ||
== Reaction(s) known to consume the compound == | == Reaction(s) known to consume the compound == | ||
| − | * [[ | + | * [[RXN-13167]] |
| + | * [[RXN-15285]] | ||
== Reaction(s) known to produce the compound == | == Reaction(s) known to produce the compound == | ||
| − | |||
| − | |||
| − | |||
== Reaction(s) of unknown directionality == | == Reaction(s) of unknown directionality == | ||
| − | {{#set: common-name= | + | {{#set: common-name=kanamycin a}} |
| + | {{#set: inchi-key=inchikey=sbujhosqtjfqjx-noamyhissa-r}} | ||
| + | {{#set: molecular-weight=488.534}} | ||
Latest revision as of 11:14, 18 March 2021
Contents
Metabolite CPD-4821
- common-name:
- kanamycin a
- smiles:
- c([n+])c1(c(o)c(o)c(o)c(o1)oc2(c([n+])cc(c(c2o)oc3(oc(co)c(o)c([n+])c(o)3))[n+]))
- inchi-key:
- sbujhosqtjfqjx-noamyhissa-r
- molecular-weight:
- 488.534
