Difference between revisions of "CPD-4821"
Jump to navigation
Jump to search
(Created page with "Category:gene == Gene SJ14711 == * transcription-direction: ** negative * right-end-position: ** 148591 * left-end-position: ** 144721 * centisome-position: ** 46.608868...") |
(Created page with "Category:metabolite == Metabolite CPD-14604 == * common-name: ** mycophenolic acid phenolic glucuronide * smiles: ** cc(ccc([o-])=o)=ccc2(=c(c(c)=c3(coc(=o)c(=c(oc1(c(o)c(...") |
||
| Line 1: | Line 1: | ||
| − | [[Category: | + | [[Category:metabolite]] |
| − | == | + | == Metabolite CPD-14604 == |
| − | * | + | * common-name: |
| − | ** | + | ** mycophenolic acid phenolic glucuronide |
| − | * | + | * smiles: |
| − | ** | + | ** cc(ccc([o-])=o)=ccc2(=c(c(c)=c3(coc(=o)c(=c(oc1(c(o)c(c(o)c(c([o-])=o)o1)o))2)3))oc) |
| − | * | + | * inchi-key: |
| − | ** | + | ** byfgtsayqqiucn-hgihdbqlsa-l |
| − | * | + | * molecular-weight: |
| − | ** | + | ** 494.451 |
| − | == | + | == Reaction(s) known to consume the compound == |
| − | + | == Reaction(s) known to produce the compound == | |
| − | == Reaction(s) | + | * [[RXN-13608]] |
| − | * [[ | + | == Reaction(s) of unknown directionality == |
| − | + | {{#set: common-name=mycophenolic acid phenolic glucuronide}} | |
| − | + | {{#set: inchi-key=inchikey=byfgtsayqqiucn-hgihdbqlsa-l}} | |
| − | + | {{#set: molecular-weight=494.451}} | |
| − | |||
| − | |||
| − | |||
| − | |||
| − | |||
| − | {{#set: | ||
| − | {{#set: | ||
| − | |||
| − | {{#set: | ||
| − | |||
| − | |||
Revision as of 20:34, 18 December 2020
Contents
Metabolite CPD-14604
- common-name:
- mycophenolic acid phenolic glucuronide
- smiles:
- cc(ccc([o-])=o)=ccc2(=c(c(c)=c3(coc(=o)c(=c(oc1(c(o)c(c(o)c(c([o-])=o)o1)o))2)3))oc)
- inchi-key:
- byfgtsayqqiucn-hgihdbqlsa-l
- molecular-weight:
- 494.451
