Difference between revisions of "CPD-488"
Jump to navigation
Jump to search
(Created page with "Category:metabolite == Metabolite CPD-9859 == * common-name: ** 6-methoxy-3-methyl-2-all-trans-heptaprenyl-1,4-benzoquinol * smiles: ** cc(c)=cccc(=cccc(=cccc(=cccc(=cccc(...") |
(Created page with "Category:metabolite == Metabolite CPD-488 == * common-name: ** β-l-fucose 1-phosphate * smiles: ** cc1(oc(op(=o)([o-])[o-])c(o)c(o)c(o)1) * inchi-key: ** ptvxqarclqpg...") |
||
| Line 1: | Line 1: | ||
[[Category:metabolite]] | [[Category:metabolite]] | ||
| − | == Metabolite CPD- | + | == Metabolite CPD-488 == |
* common-name: | * common-name: | ||
| − | ** | + | ** β-l-fucose 1-phosphate |
* smiles: | * smiles: | ||
| − | ** | + | ** cc1(oc(op(=o)([o-])[o-])c(o)c(o)c(o)1) |
* inchi-key: | * inchi-key: | ||
| − | ** | + | ** ptvxqarclqpgir-sxuwkvjysa-l |
* molecular-weight: | * molecular-weight: | ||
| − | ** | + | ** 242.122 |
== Reaction(s) known to consume the compound == | == Reaction(s) known to consume the compound == | ||
== Reaction(s) known to produce the compound == | == Reaction(s) known to produce the compound == | ||
| − | * [[RXN | + | * [[FUCOKINASE-RXN]] |
== Reaction(s) of unknown directionality == | == Reaction(s) of unknown directionality == | ||
| − | {{#set: common-name= | + | {{#set: common-name=β-l-fucose 1-phosphate}} |
| − | {{#set: inchi-key=inchikey= | + | {{#set: inchi-key=inchikey=ptvxqarclqpgir-sxuwkvjysa-l}} |
| − | {{#set: molecular-weight= | + | {{#set: molecular-weight=242.122}} |
Latest revision as of 11:16, 18 March 2021
Contents
Metabolite CPD-488
- common-name:
- β-l-fucose 1-phosphate
- smiles:
- cc1(oc(op(=o)([o-])[o-])c(o)c(o)c(o)1)
- inchi-key:
- ptvxqarclqpgir-sxuwkvjysa-l
- molecular-weight:
- 242.122
