Difference between revisions of "CPD-488"

From metabolic_network
Jump to navigation Jump to search
(Created page with "Category:metabolite == Metabolite CPD-9857 == * common-name: ** 2-methoxy-6-(all-trans-heptaprenyl)phenol * smiles: ** cc(c)=cccc(=cccc(=cccc(=cccc(=cccc(=cccc(=ccc1(c(o)=...")
(Created page with "Category:metabolite == Metabolite PHOSPHORIBULOSYL-FORMIMINO-AICAR-P == * common-name: ** phosphoribulosylformimino-aicar-phosphate * smiles: ** c(op(=o)([o-])[o-])c(o)c(o...")
Line 1: Line 1:
 
[[Category:metabolite]]
 
[[Category:metabolite]]
== Metabolite CPD-9857 ==
+
== Metabolite PHOSPHORIBULOSYL-FORMIMINO-AICAR-P ==
 
* common-name:
 
* common-name:
** 2-methoxy-6-(all-trans-heptaprenyl)phenol
+
** phosphoribulosylformimino-aicar-phosphate
 
* smiles:
 
* smiles:
** cc(c)=cccc(=cccc(=cccc(=cccc(=cccc(=cccc(=ccc1(c(o)=c(oc)c=cc=1))c)c)c)c)c)c
+
** c(op(=o)([o-])[o-])c(o)c(o)c(=o)cn=cnc2(n(c1(c(o)c(c(cop(=o)([o-])[o-])o1)o))c=nc(c(=o)n)=2)
 
* inchi-key:
 
* inchi-key:
** ywvpprxiddchcq-cuhbluqcsa-n
+
** blkfnhochnclii-ghvqhmavsa-j
 
* molecular-weight:
 
* molecular-weight:
** 600.966
+
** 573.303
 
== Reaction(s) known to consume the compound ==
 
== Reaction(s) known to consume the compound ==
 +
* [[GLUTAMIDOTRANS-RXN]]
 +
* [[RXN-17900]]
 
== Reaction(s) known to produce the compound ==
 
== Reaction(s) known to produce the compound ==
* [[RXN-9225]]
+
* [[PRIBFAICARPISOM-RXN]]
 +
* [[PRICI]]
 
== Reaction(s) of unknown directionality ==
 
== Reaction(s) of unknown directionality ==
{{#set: common-name=2-methoxy-6-(all-trans-heptaprenyl)phenol}}
+
{{#set: common-name=phosphoribulosylformimino-aicar-phosphate}}
{{#set: inchi-key=inchikey=ywvpprxiddchcq-cuhbluqcsa-n}}
+
{{#set: inchi-key=inchikey=blkfnhochnclii-ghvqhmavsa-j}}
{{#set: molecular-weight=600.966}}
+
{{#set: molecular-weight=573.303}}

Revision as of 18:57, 14 January 2021

Metabolite PHOSPHORIBULOSYL-FORMIMINO-AICAR-P

  • common-name:
    • phosphoribulosylformimino-aicar-phosphate
  • smiles:
    • c(op(=o)([o-])[o-])c(o)c(o)c(=o)cn=cnc2(n(c1(c(o)c(c(cop(=o)([o-])[o-])o1)o))c=nc(c(=o)n)=2)
  • inchi-key:
    • blkfnhochnclii-ghvqhmavsa-j
  • molecular-weight:
    • 573.303

Reaction(s) known to consume the compound

Reaction(s) known to produce the compound

Reaction(s) of unknown directionality