Difference between revisions of "CPD-490"
Jump to navigation
Jump to search
(Created page with "Category:metabolite == Metabolite 3-HYDROXY-ISOVALERYL-COA == * common-name: ** 3-hydroxyisovaleryl-coa * smiles: ** cc(cop(=o)([o-])op(=o)([o-])occ3(c(c(c(n2(c=nc1(c(=nc=...") |
(Created page with "Category:metabolite == Metabolite CPD-490 == * common-name: ** α-d-xylose 1-phosphate * smiles: ** c1(c(c(c(co1)o)o)o)op([o-])([o-])=o * inchi-key: ** ilxhfxfppzgenn...") |
||
| (5 intermediate revisions by 3 users not shown) | |||
| Line 1: | Line 1: | ||
[[Category:metabolite]] | [[Category:metabolite]] | ||
| − | == Metabolite | + | == Metabolite CPD-490 == |
* common-name: | * common-name: | ||
| − | ** | + | ** α-d-xylose 1-phosphate |
* smiles: | * smiles: | ||
| − | ** | + | ** c1(c(c(c(co1)o)o)o)op([o-])([o-])=o |
* inchi-key: | * inchi-key: | ||
| − | ** | + | ** ilxhfxfppzgenn-kkqcnmdgsa-l |
* molecular-weight: | * molecular-weight: | ||
| − | ** | + | ** 228.095 |
== Reaction(s) known to consume the compound == | == Reaction(s) known to consume the compound == | ||
| − | * [[ | + | * [[2.7.7.11-RXN]] |
| − | |||
== Reaction(s) known to produce the compound == | == Reaction(s) known to produce the compound == | ||
| − | * [[ | + | * [[2.7.7.11-RXN]] |
| − | |||
== Reaction(s) of unknown directionality == | == Reaction(s) of unknown directionality == | ||
| − | {{#set: common-name= | + | {{#set: common-name=α-d-xylose 1-phosphate}} |
| − | {{#set: inchi-key=inchikey= | + | {{#set: inchi-key=inchikey=ilxhfxfppzgenn-kkqcnmdgsa-l}} |
| − | {{#set: molecular-weight= | + | {{#set: molecular-weight=228.095}} |
Latest revision as of 11:12, 18 March 2021
Contents
Metabolite CPD-490
- common-name:
- α-d-xylose 1-phosphate
- smiles:
- c1(c(c(c(co1)o)o)o)op([o-])([o-])=o
- inchi-key:
- ilxhfxfppzgenn-kkqcnmdgsa-l
- molecular-weight:
- 228.095
