Difference between revisions of "CPD-490"
Jump to navigation
Jump to search
(Created page with "Category:metabolite == Metabolite TRIPEPTIDES == * common-name: ** a tripeptide == Reaction(s) known to consume the compound == * 3.4.11.4-RXN == Reaction(s) known to...") |
(Created page with "Category:metabolite == Metabolite CPD-490 == * common-name: ** α-d-xylose 1-phosphate * smiles: ** c1(c(c(c(co1)o)o)o)op([o-])([o-])=o * inchi-key: ** ilxhfxfppzgenn...") |
||
(2 intermediate revisions by 2 users not shown) | |||
Line 1: | Line 1: | ||
[[Category:metabolite]] | [[Category:metabolite]] | ||
− | == Metabolite | + | == Metabolite CPD-490 == |
* common-name: | * common-name: | ||
− | ** | + | ** α-d-xylose 1-phosphate |
+ | * smiles: | ||
+ | ** c1(c(c(c(co1)o)o)o)op([o-])([o-])=o | ||
+ | * inchi-key: | ||
+ | ** ilxhfxfppzgenn-kkqcnmdgsa-l | ||
+ | * molecular-weight: | ||
+ | ** 228.095 | ||
== Reaction(s) known to consume the compound == | == Reaction(s) known to consume the compound == | ||
− | * [[ | + | * [[2.7.7.11-RXN]] |
== Reaction(s) known to produce the compound == | == Reaction(s) known to produce the compound == | ||
− | * [[ | + | * [[2.7.7.11-RXN]] |
− | |||
== Reaction(s) of unknown directionality == | == Reaction(s) of unknown directionality == | ||
− | {{#set: common-name= | + | {{#set: common-name=α-d-xylose 1-phosphate}} |
+ | {{#set: inchi-key=inchikey=ilxhfxfppzgenn-kkqcnmdgsa-l}} | ||
+ | {{#set: molecular-weight=228.095}} |
Latest revision as of 11:12, 18 March 2021
Contents
Metabolite CPD-490
- common-name:
- α-d-xylose 1-phosphate
- smiles:
- c1(c(c(c(co1)o)o)o)op([o-])([o-])=o
- inchi-key:
- ilxhfxfppzgenn-kkqcnmdgsa-l
- molecular-weight:
- 228.095