Difference between revisions of "CPD-490"
Jump to navigation
Jump to search
(Created page with "Category:gene == Gene SJ10683 == * transcription-direction: ** negative * right-end-position: ** 537374 * left-end-position: ** 531338 * centisome-position: ** 67.41995...") |
(Created page with "Category:metabolite == Metabolite CPD-490 == * common-name: ** α-d-xylose 1-phosphate * smiles: ** c1(c(c(c(co1)o)o)o)op([o-])([o-])=o * inchi-key: ** ilxhfxfppzgenn...") |
||
| (8 intermediate revisions by 4 users not shown) | |||
| Line 1: | Line 1: | ||
| − | [[Category: | + | [[Category:metabolite]] |
| − | == | + | == Metabolite CPD-490 == |
| − | * | + | * common-name: |
| − | ** | + | ** α-d-xylose 1-phosphate |
| − | * | + | * smiles: |
| − | ** | + | ** c1(c(c(c(co1)o)o)o)op([o-])([o-])=o |
| − | * | + | * inchi-key: |
| − | ** | + | ** ilxhfxfppzgenn-kkqcnmdgsa-l |
| − | * | + | * molecular-weight: |
| − | ** | + | ** 228.095 |
| − | == | + | == Reaction(s) known to consume the compound == |
| − | * [[ | + | * [[2.7.7.11-RXN]] |
| − | == Reaction(s) | + | == Reaction(s) known to produce the compound == |
| − | * [[ | + | * [[2.7.7.11-RXN]] |
| − | + | == Reaction(s) of unknown directionality == | |
| − | + | {{#set: common-name=α-d-xylose 1-phosphate}} | |
| − | + | {{#set: inchi-key=inchikey=ilxhfxfppzgenn-kkqcnmdgsa-l}} | |
| − | + | {{#set: molecular-weight=228.095}} | |
| − | {{#set: | ||
| − | {{#set: | ||
| − | |||
| − | {{#set: | ||
| − | |||
| − | |||
Latest revision as of 11:12, 18 March 2021
Contents
Metabolite CPD-490
- common-name:
- α-d-xylose 1-phosphate
- smiles:
- c1(c(c(c(co1)o)o)o)op([o-])([o-])=o
- inchi-key:
- ilxhfxfppzgenn-kkqcnmdgsa-l
- molecular-weight:
- 228.095
