Difference between revisions of "CPD-497"
Jump to navigation
Jump to search
(Created page with "Category:metabolite == Metabolite 2E-11Z-icosa-2-11-dienoyl-ACPs == * common-name: ** an (2e,11z)-icosa-2,11-dienoyl-[acp] == Reaction(s) known to consume the compound ==...") |
(Created page with "Category:metabolite == Metabolite CPD-497 == * common-name: ** pseudouridine * smiles: ** c1(nc(=o)nc(=o)c=1c2(oc(co)c(o)c(o)2)) * inchi-key: ** ptjwiqphwpfnbw-gbndhiklsa-...") |
||
| (One intermediate revision by one other user not shown) | |||
| Line 1: | Line 1: | ||
[[Category:metabolite]] | [[Category:metabolite]] | ||
| − | == Metabolite | + | == Metabolite CPD-497 == |
* common-name: | * common-name: | ||
| − | ** | + | ** pseudouridine |
| + | * smiles: | ||
| + | ** c1(nc(=o)nc(=o)c=1c2(oc(co)c(o)c(o)2)) | ||
| + | * inchi-key: | ||
| + | ** ptjwiqphwpfnbw-gbndhiklsa-n | ||
| + | * molecular-weight: | ||
| + | ** 244.204 | ||
== Reaction(s) known to consume the compound == | == Reaction(s) known to consume the compound == | ||
| − | * [[RXN- | + | * [[PSEUDOURIDINE-KINASE-RXN]] |
| + | * [[RXN-15703]] | ||
== Reaction(s) known to produce the compound == | == Reaction(s) known to produce the compound == | ||
| − | * [[RXN- | + | * [[RXN-15703]] |
== Reaction(s) of unknown directionality == | == Reaction(s) of unknown directionality == | ||
| − | {{#set: common-name= | + | {{#set: common-name=pseudouridine}} |
| + | {{#set: inchi-key=inchikey=ptjwiqphwpfnbw-gbndhiklsa-n}} | ||
| + | {{#set: molecular-weight=244.204}} | ||
Latest revision as of 11:15, 18 March 2021
Contents
Metabolite CPD-497
- common-name:
- pseudouridine
- smiles:
- c1(nc(=o)nc(=o)c=1c2(oc(co)c(o)c(o)2))
- inchi-key:
- ptjwiqphwpfnbw-gbndhiklsa-n
- molecular-weight:
- 244.204
