Difference between revisions of "CPD-497"

From metabolic_network
Jump to navigation Jump to search
(Created page with "Category:reaction == Reaction [http://metacyc.org/META/NEW-IMAGE?object=RXN3DJ-11230 RXN3DJ-11230] == * direction: ** left-to-right * ec-number: ** [http://enzyme.expasy.o...")
(Created page with "Category:metabolite == Metabolite CPD-497 == * common-name: ** pseudouridine * smiles: ** c1(nc(=o)nc(=o)c=1c2(oc(co)c(o)c(o)2)) * inchi-key: ** ptjwiqphwpfnbw-gbndhiklsa-...")
 
(8 intermediate revisions by 3 users not shown)
Line 1: Line 1:
[[Category:reaction]]
+
[[Category:metabolite]]
== Reaction [http://metacyc.org/META/NEW-IMAGE?object=RXN3DJ-11230 RXN3DJ-11230] ==
+
== Metabolite CPD-497 ==
* direction:
+
* common-name:
** left-to-right
+
** pseudouridine
* ec-number:
+
* smiles:
** [http://enzyme.expasy.org/EC/4.3.2 ec-4.3.2]
+
** c1(nc(=o)nc(=o)c=1c2(oc(co)c(o)c(o)2))
== Reaction formula ==
+
* inchi-key:
* 1 [[CPD3DJ-11366]][c] '''=>''' 1 [[CPD-292]][c] '''+''' 1 [[PHOSPHORYL-ETHANOLAMINE]][c]
+
** ptjwiqphwpfnbw-gbndhiklsa-n
== Gene(s) associated with this reaction  ==
+
* molecular-weight:
* Gene: [[SJ19063]]
+
** 244.204
** Category: [[orthology]]
+
== Reaction(s) known to consume the compound ==
*** Source: [[output_pantograph_arabidopsis_thaliana]], Tool: [[pantograph]], Assignment: n.a, Comment: n.a
+
* [[PSEUDOURIDINE-KINASE-RXN]]
*** Source: [[output_pantograph_ectocarpus_siliculosus]], Tool: [[pantograph]], Assignment: n.a, Comment: n.a
+
* [[RXN-15703]]
== Pathway(s) ==
+
== Reaction(s) known to produce the compound ==
* [[PWY3DJ-11470]], sphingosine and sphingosine-1-phosphate metabolism: [http://metacyc.org/META/NEW-IMAGE?object=PWY3DJ-11470 PWY3DJ-11470]
+
* [[RXN-15703]]
** '''3''' reactions found over '''8''' reactions in the full pathway
+
== Reaction(s) of unknown directionality ==
== Reconstruction information  ==
+
{{#set: common-name=pseudouridine}}
* category: [[orthology]]; source: [[output_pantograph_arabidopsis_thaliana]]; tool: [[pantograph]]; comment: n.a
+
{{#set: inchi-key=inchikey=ptjwiqphwpfnbw-gbndhiklsa-n}}
* category: [[orthology]]; source: [[output_pantograph_ectocarpus_siliculosus]]; tool: [[pantograph]]; comment: n.a
+
{{#set: molecular-weight=244.204}}
== External links  ==
 
* RHEA:
 
** [http://www.ebi.ac.uk/rhea/reaction.xhtml?id=33508 33508]
 
* LIGAND-RXN:
 
** [http://www.genome.jp/dbget-bin/www_bget?R06516 R06516]
 
{{#set: direction=left-to-right}}
 
{{#set: ec-number=ec-4.3.2}}
 
{{#set: nb gene associated=1}}
 
{{#set: nb pathway associated=1}}
 
{{#set: reconstruction category=orthology}}
 
{{#set: reconstruction tool=pantograph}}
 
{{#set: reconstruction comment=n.a}}
 
{{#set: reconstruction source=output_pantograph_arabidopsis_thaliana|output_pantograph_ectocarpus_siliculosus}}
 

Latest revision as of 11:15, 18 March 2021

Metabolite CPD-497

  • common-name:
    • pseudouridine
  • smiles:
    • c1(nc(=o)nc(=o)c=1c2(oc(co)c(o)c(o)2))
  • inchi-key:
    • ptjwiqphwpfnbw-gbndhiklsa-n
  • molecular-weight:
    • 244.204

Reaction(s) known to consume the compound

Reaction(s) known to produce the compound

Reaction(s) of unknown directionality