Difference between revisions of "CPD-497"

From metabolic_network
Jump to navigation Jump to search
(Created page with "Category:metabolite == Metabolite ETHANOL-AMINE == * common-name: ** ethanolamine * smiles: ** c(co)[n+] * inchi-key: ** hzaxfhjvjlsvmw-uhfffaoysa-o * molecular-weight: **...")
(Created page with "Category:metabolite == Metabolite CPD-497 == * common-name: ** pseudouridine * smiles: ** c1(nc(=o)nc(=o)c=1c2(oc(co)c(o)c(o)2)) * inchi-key: ** ptjwiqphwpfnbw-gbndhiklsa-...")
 
(2 intermediate revisions by 2 users not shown)
Line 1: Line 1:
 
[[Category:metabolite]]
 
[[Category:metabolite]]
== Metabolite ETHANOL-AMINE ==
+
== Metabolite CPD-497 ==
 
* common-name:
 
* common-name:
** ethanolamine
+
** pseudouridine
 
* smiles:
 
* smiles:
** c(co)[n+]
+
** c1(nc(=o)nc(=o)c=1c2(oc(co)c(o)c(o)2))
 
* inchi-key:
 
* inchi-key:
** hzaxfhjvjlsvmw-uhfffaoysa-o
+
** ptjwiqphwpfnbw-gbndhiklsa-n
 
* molecular-weight:
 
* molecular-weight:
** 62.091
+
** 244.204
 
== Reaction(s) known to consume the compound ==
 
== Reaction(s) known to consume the compound ==
* [[ETHANOLAMINE-KINASE-RXN]]
+
* [[PSEUDOURIDINE-KINASE-RXN]]
* [[RXN-1382]]
+
* [[RXN-15703]]
 
== Reaction(s) known to produce the compound ==
 
== Reaction(s) known to produce the compound ==
* [[RXN-1382]]
+
* [[RXN-15703]]
* [[RXN-14160]]
 
* [[RXN-7948]]
 
* [[RXN6666-2]]
 
 
== Reaction(s) of unknown directionality ==
 
== Reaction(s) of unknown directionality ==
{{#set: common-name=ethanolamine}}
+
{{#set: common-name=pseudouridine}}
{{#set: inchi-key=inchikey=hzaxfhjvjlsvmw-uhfffaoysa-o}}
+
{{#set: inchi-key=inchikey=ptjwiqphwpfnbw-gbndhiklsa-n}}
{{#set: molecular-weight=62.091}}
+
{{#set: molecular-weight=244.204}}

Latest revision as of 11:15, 18 March 2021

Metabolite CPD-497

  • common-name:
    • pseudouridine
  • smiles:
    • c1(nc(=o)nc(=o)c=1c2(oc(co)c(o)c(o)2))
  • inchi-key:
    • ptjwiqphwpfnbw-gbndhiklsa-n
  • molecular-weight:
    • 244.204

Reaction(s) known to consume the compound

Reaction(s) known to produce the compound

Reaction(s) of unknown directionality