Difference between revisions of "CPD-497"

From metabolic_network
Jump to navigation Jump to search
(Created page with "Category:reaction == Reaction [http://metacyc.org/META/NEW-IMAGE?object=THIAZOLSYN2-RXN THIAZOLSYN2-RXN] == * direction: ** left-to-right * common-name: ** 1-deoxy-d-xylul...")
(Created page with "Category:metabolite == Metabolite CPD-12124 == * common-name: ** menaquinol-6 * smiles: ** cc(=cccc(c)=cccc(c)=cccc(c)=cccc(c)=cccc(c)=ccc2(c(c)=c(o)c1(c=cc=cc=1c(o)=2)))c...")
Line 1: Line 1:
−
[[Category:reaction]]
+
[[Category:metabolite]]
−
== Reaction [http://metacyc.org/META/NEW-IMAGE?object=THIAZOLSYN2-RXN THIAZOLSYN2-RXN] ==
+
== Metabolite CPD-12124 ==
−
* direction:
 
−
** left-to-right
 
 
* common-name:
 
* common-name:
−
** 1-deoxy-d-xylulose 5-phosphate:thiol sulfurtransferase
+
** menaquinol-6
−
* ec-number:
+
* smiles:
−
** [http://enzyme.expasy.org/EC/2.8.1.10 ec-2.8.1.10]
+
** cc(=cccc(c)=cccc(c)=cccc(c)=cccc(c)=cccc(c)=ccc2(c(c)=c(o)c1(c=cc=cc=1c(o)=2)))c
−
== Reaction formula ==
+
* inchi-key:
−
* 1 [[CPD-12279]][c] '''+''' 1 [[DEOXYXYLULOSE-5P]][c] '''+''' 1 [[Thiocarboxyadenylated-ThiS-Proteins]][c] '''=>''' 1 [[CPD-13575]][c] '''+''' 1 [[Thi-S]][c] '''+''' 2 [[WATER]][c]
+
** zventdgzqvbwna-rciygobdsa-n
−
== Gene(s) associated with this reaction  ==
+
* molecular-weight:
−
* Gene: [[SJ17412]]
+
** 582.908
−
** Category: [[annotation]]
+
== Reaction(s) known to consume the compound ==
−
*** Source: [[saccharina_japonica_genome]], Tool: [[pathwaytools]], Assignment: ec-number, Comment: n.a
+
== Reaction(s) known to produce the compound ==
−
== Pathway(s) ==
+
* [[RXN-9220]]
−
* [[PWY-6891]], thiazole biosynthesis II (aerobic bacteria): [http://metacyc.org/META/NEW-IMAGE?object=PWY-6891 PWY-6891]
+
== Reaction(s) of unknown directionality ==
−
** '''4''' reactions found over '''7''' reactions in the full pathway
+
{{#set: common-name=menaquinol-6}}
−
* [[PWY-6892]], thiazole biosynthesis I (facultative anaerobic bacteria): [http://metacyc.org/META/NEW-IMAGE?object=PWY-6892 PWY-6892]
+
{{#set: inchi-key=inchikey=zventdgzqvbwna-rciygobdsa-n}}
−
** '''5''' reactions found over '''7''' reactions in the full pathway
+
{{#set: molecular-weight=582.908}}
−
== Reconstruction information  ==
 
−
* category: [[annotation]]; source: [[saccharina_japonica_genome]]; tool: [[pathwaytools]]; comment: n.a
 
−
== External links  ==
 
−
* LIGAND-RXN:
 
−
** [http://www.genome.jp/dbget-bin/www_bget?R10247 R10247]
 
−
* RHEA:
 
−
** [http://www.ebi.ac.uk/rhea/reaction.xhtml?id=26300 26300]
 
−
{{#set: direction=left-to-right}}
 
−
{{#set: common-name=1-deoxy-d-xylulose 5-phosphate:thiol sulfurtransferase}}
 
−
{{#set: ec-number=ec-2.8.1.10}}
 
−
{{#set: nb gene associated=1}}
 
−
{{#set: nb pathway associated=2}}
 
−
{{#set: reconstruction category=annotation}}
 
−
{{#set: reconstruction tool=pathwaytools}}
 
−
{{#set: reconstruction comment=n.a}}
 
−
{{#set: reconstruction source=saccharina_japonica_genome}}
 

Revision as of 20:35, 18 December 2020

Metabolite CPD-12124

  • common-name:
    • menaquinol-6
  • smiles:
    • cc(=cccc(c)=cccc(c)=cccc(c)=cccc(c)=cccc(c)=ccc2(c(c)=c(o)c1(c=cc=cc=1c(o)=2)))c
  • inchi-key:
    • zventdgzqvbwna-rciygobdsa-n
  • molecular-weight:
    • 582.908

Reaction(s) known to consume the compound

Reaction(s) known to produce the compound

Reaction(s) of unknown directionality

Retrieved from "https://gem-aureme.genouest.org/sjapgem/index.php?title=CPD-497&oldid=47657"