Difference between revisions of "CPD-497"
Jump to navigation
Jump to search
(Created page with "Category:metabolite == Metabolite CPD-15036 == * common-name: ** 5-dehydro-4-deoxy-2-o-sulfo-d-glucuronate * smiles: ** c(=o)c(os([o-])(=o)=o)c(o)cc(=o)c(=o)[o-] * inchi-k...") |
(Created page with "Category:metabolite == Metabolite ETHANOL-AMINE == * common-name: ** ethanolamine * smiles: ** c(co)[n+] * inchi-key: ** hzaxfhjvjlsvmw-uhfffaoysa-o * molecular-weight: **...") |
||
| Line 1: | Line 1: | ||
[[Category:metabolite]] | [[Category:metabolite]] | ||
| − | == Metabolite | + | == Metabolite ETHANOL-AMINE == |
* common-name: | * common-name: | ||
| − | ** | + | ** ethanolamine |
* smiles: | * smiles: | ||
| − | ** c( | + | ** c(co)[n+] |
* inchi-key: | * inchi-key: | ||
| − | ** | + | ** hzaxfhjvjlsvmw-uhfffaoysa-o |
* molecular-weight: | * molecular-weight: | ||
| − | ** | + | ** 62.091 |
== Reaction(s) known to consume the compound == | == Reaction(s) known to consume the compound == | ||
| + | * [[ETHANOLAMINE-KINASE-RXN]] | ||
| + | * [[RXN-1382]] | ||
== Reaction(s) known to produce the compound == | == Reaction(s) known to produce the compound == | ||
| − | * [[RXN- | + | * [[RXN-1382]] |
| + | * [[RXN-14160]] | ||
| + | * [[RXN-7948]] | ||
| + | * [[RXN6666-2]] | ||
== Reaction(s) of unknown directionality == | == Reaction(s) of unknown directionality == | ||
| − | {{#set: common-name= | + | {{#set: common-name=ethanolamine}} |
| − | {{#set: inchi-key=inchikey= | + | {{#set: inchi-key=inchikey=hzaxfhjvjlsvmw-uhfffaoysa-o}} |
| − | {{#set: molecular-weight= | + | {{#set: molecular-weight=62.091}} |
Revision as of 13:11, 14 January 2021
Contents
Metabolite ETHANOL-AMINE
- common-name:
- ethanolamine
- smiles:
- c(co)[n+]
- inchi-key:
- hzaxfhjvjlsvmw-uhfffaoysa-o
- molecular-weight:
- 62.091
