|
|
| (8 intermediate revisions by 4 users not shown) |
| Line 1: |
Line 1: |
| − | [[Category:gene]] | + | [[Category:metabolite]] |
| − | == Gene SJ07213 == | + | == Metabolite CPD-499 == |
| − | * transcription-direction: | + | * common-name: |
| − | ** positive | + | ** (r)-mevalonate 5-phosphate |
| − | * right-end-position:
| + | * smiles: |
| − | ** 869220 | + | ** cc(o)(ccop(=o)([o-])[o-])cc(=o)[o-] |
| − | * left-end-position:
| + | * inchi-key: |
| − | ** 854707 | + | ** okzycxhttzzysk-zcfiwibfsa-k |
| − | * centisome-position:
| + | * molecular-weight: |
| − | ** 58.49846
| + | ** 225.115 |
| − | == Organism(s) associated with this gene ==
| + | == Reaction(s) known to consume the compound == |
| − | * [[S.japonica_carotenoid_curated]]
| + | * [[MEVALONATE-KINASE-RXN]] |
| − | == Reaction(s) associated ==
| + | * [[PHOSPHOMEVALONATE-KINASE-RXN]] |
| − | <div class="toccolours mw-collapsible mw-collapsed" style="width:100%; overflow:auto;">
| + | == Reaction(s) known to produce the compound == |
| − | * [[GPPSYN-RXN]]
| + | * [[MEVALONATE-KINASE-RXN]] |
| − | ** Category: [[annotation]]
| + | * [[PHOSPHOMEVALONATE-KINASE-RXN]] |
| − | *** source: [[saccharina_japonica_genome]]; tool: [[pathwaytools]]; comment: n.a
| + | == Reaction(s) of unknown directionality == |
| − | ** Category: [[orthology]]
| + | {{#set: common-name=(r)-mevalonate 5-phosphate}} |
| − | *** source: [[output_pantograph_ectocarpus_siliculosus]]; tool: [[pantograph]]; comment: n.a
| + | {{#set: inchi-key=inchikey=okzycxhttzzysk-zcfiwibfsa-k}} |
| − | * [[RXN-17480]]
| + | {{#set: molecular-weight=225.115}} |
| − | ** Category: [[annotation]]
| |
| − | *** source: [[saccharina_japonica_genome]]; tool: [[pathwaytools]]; comment: n.a
| |
| − | * [[RXN-7663]]
| |
| − | ** Category: [[annotation]]
| |
| − | *** source: [[saccharina_japonica_genome]]; tool: [[pathwaytools]]; comment: n.a | |
| − | ** Category: [[orthology]]
| |
| − | *** source: [[output_pantograph_nannochloropsis_salina]]; tool: [[pantograph]]; comment: n.a
| |
| − | * [[RXN-7673]]
| |
| − | ** Category: [[annotation]]
| |
| − | *** source: [[saccharina_japonica_genome]]; tool: [[pathwaytools]]; comment: n.a | |
| − | * [[RXN-7674]]
| |
| − | ** Category: [[annotation]]
| |
| − | *** source: [[saccharina_japonica_genome]]; tool: [[pathwaytools]]; comment: n.a
| |
| − | ** Category: [[orthology]]
| |
| − | *** source: [[output_pantograph_nannochloropsis_salina]]; tool: [[pantograph]]; comment: n.a
| |
| − | * [[RXN-8788]]
| |
| − | ** Category: [[annotation]]
| |
| − | *** source: [[saccharina_japonica_genome]]; tool: [[pathwaytools]]; comment: n.a | |
| − | * [[RXN1F-66]]
| |
| − | ** Category: [[annotation]]
| |
| − | *** source: [[saccharina_japonica_genome]]; tool: [[pathwaytools]]; comment: n.a | |
| − | ** Category: [[orthology]]
| |
| − | *** source: [[output_pantograph_nannochloropsis_salina]]; tool: [[pantograph]]; comment: n.a
| |
| − | </div>
| |
| − | == Pathway(s) associated == | |
| − | <div class="toccolours mw-collapsible mw-collapsed" style="width:100%; overflow:auto;">
| |
| − | * [[PWY-6383]] | |
| − | ** '''2''' reactions found over '''5''' reactions in the full pathway
| |
| − | * [[PWY-7410]]
| |
| − | ** '''1''' reactions found over '''4''' reactions in the full pathway
| |
| − | * [[PWY-7102]] | |
| − | ** '''3''' reactions found over '''6''' reactions in the full pathway
| |
| − | * [[PWY-6859]]
| |
| − | ** '''3''' reactions found over '''4''' reactions in the full pathway
| |
| − | * [[PWY-7736]] | |
| − | ** '''3''' reactions found over '''8''' reactions in the full pathway
| |
| − | * [[PWY-5122]]
| |
| − | ** '''1''' reactions found over '''1''' reactions in the full pathway
| |
| − | * [[PWY-7141]] | |
| − | ** '''1''' reactions found over '''2''' reactions in the full pathway
| |
| − | * [[PWY-7659]]
| |
| − | ** '''1''' reactions found over '''9''' reactions in the full pathway
| |
| − | * [[PWY-7709]]
| |
| − | ** '''1''' reactions found over '''2''' reactions in the full pathway
| |
| − | * [[PWY-5123]]
| |
| − | ** '''3''' reactions found over '''3''' reactions in the full pathway
| |
| − | * [[PWY-7182]]
| |
| − | ** '''1''' reactions found over '''2''' reactions in the full pathway
| |
| − | * [[PWY-7762]]
| |
| − | ** '''4''' reactions found over '''7''' reactions in the full pathway
| |
| − | * [[PWY-5064]]
| |
| − | ** '''5''' reactions found over '''5''' reactions in the full pathway
| |
| − | * [[PWY-5068]]
| |
| − | ** '''4''' reactions found over '''7''' reactions in the full pathway
| |
| − | * [[PWY-5526]]
| |
| − | ** '''5''' reactions found over '''13''' reactions in the full pathway
| |
| − | * [[PWY-7764]]
| |
| − | ** '''1''' reactions found over '''2''' reactions in the full pathway
| |
| − | * [[PWY-5086]]
| |
| − | ** '''2''' reactions found over '''2''' reactions in the full pathway
| |
| − | </div>
| |
| − | {{#set: transcription-direction=positive}} | |
| − | {{#set: right-end-position=869220}} | |
| − | {{#set: left-end-position=854707}}
| |
| − | {{#set: centisome-position=58.49846 }} | |
| − | {{#set: organism associated=S.japonica_carotenoid_curated}}
| |
| − | {{#set: nb reaction associated=7}}
| |
| − | {{#set: nb pathway associated=17}}
| |
