Difference between revisions of "CPD-499"

From metabolic_network
Jump to navigation Jump to search
(Created page with "Category:gene == Gene SJ16350 == * transcription-direction: ** positive * right-end-position: ** 260995 * left-end-position: ** 245127 * centisome-position: ** 86.04571...")
(Created page with "Category:metabolite == Metabolite CPD-499 == * common-name: ** (r)-mevalonate 5-phosphate * smiles: ** cc(o)(ccop(=o)([o-])[o-])cc(=o)[o-] * inchi-key: ** okzycxhttzzysk-z...")
 
(7 intermediate revisions by 3 users not shown)
Line 1: Line 1:
−
[[Category:gene]]
+
[[Category:metabolite]]
−
== Gene SJ16350 ==
+
== Metabolite CPD-499 ==
−
* transcription-direction:
+
* common-name:
−
** positive
+
** (r)-mevalonate 5-phosphate
−
* right-end-position:
+
* smiles:
−
** 260995
+
** cc(o)(ccop(=o)([o-])[o-])cc(=o)[o-]
−
* left-end-position:
+
* inchi-key:
−
** 245127
+
** okzycxhttzzysk-zcfiwibfsa-k
−
* centisome-position:
+
* molecular-weight:
−
** 86.04571   
+
** 225.115
−
== Organism(s) associated with this gene  ==
+
== Reaction(s) known to consume the compound ==
−
* [[S.japonica_carotenoid_curated]]
+
* [[MEVALONATE-KINASE-RXN]]
−
== Reaction(s) associated ==
+
* [[PHOSPHOMEVALONATE-KINASE-RXN]]
−
* [[ATPASE-RXN]]
+
== Reaction(s) known to produce the compound ==
−
** Category: [[annotation]]
+
* [[MEVALONATE-KINASE-RXN]]
−
*** source: [[saccharina_japonica_genome]]; tool: [[pathwaytools]]; comment: n.a
+
* [[PHOSPHOMEVALONATE-KINASE-RXN]]
−
* [[NUCLEOSIDE-TRIPHOSPHATASE-RXN]]
+
== Reaction(s) of unknown directionality ==
−
** Category: [[annotation]]
+
{{#set: common-name=(r)-mevalonate 5-phosphate}}
−
*** source: [[saccharina_japonica_genome]]; tool: [[pathwaytools]]; comment: n.a
+
{{#set: inchi-key=inchikey=okzycxhttzzysk-zcfiwibfsa-k}}
−
* [[RXN-11109]]
+
{{#set: molecular-weight=225.115}}
−
** Category: [[annotation]]
 
−
*** source: [[saccharina_japonica_genome]]; tool: [[pathwaytools]]; comment: n.a
 
−
* [[RXN-12195]]
 
−
** Category: [[annotation]]
 
−
*** source: [[saccharina_japonica_genome]]; tool: [[pathwaytools]]; comment: n.a
 
−
* [[RXN-12196]]
 
−
** Category: [[annotation]]
 
−
*** source: [[saccharina_japonica_genome]]; tool: [[pathwaytools]]; comment: n.a
 
−
* [[RXN0-5462]]
 
−
** Category: [[annotation]]
 
−
*** source: [[saccharina_japonica_genome]]; tool: [[pathwaytools]]; comment: n.a
 
−
== Pathway(s) associated ==
 
−
* [[PWY-7210]]
 
−
** '''8''' reactions found over '''8''' reactions in the full pathway
 
−
* [[PWY-7198]]
 
−
** '''6''' reactions found over '''7''' reactions in the full pathway
 
−
* [[PWY-7184]]
 
−
** '''9''' reactions found over '''9''' reactions in the full pathway
 
−
* [[PWY-6545]]
 
−
** '''8''' reactions found over '''9''' reactions in the full pathway
 
−
{{#set: transcription-direction=positive}}
 
−
{{#set: right-end-position=260995}}
 
−
{{#set: left-end-position=245127}}
 
−
{{#set: centisome-position=86.04571    }}
 
−
{{#set: organism associated=S.japonica_carotenoid_curated}}
 
−
{{#set: nb reaction associated=6}}
 
−
{{#set: nb pathway associated=4}}
 

Latest revision as of 11:13, 18 March 2021

Metabolite CPD-499

  • common-name:
    • (r)-mevalonate 5-phosphate
  • smiles:
    • cc(o)(ccop(=o)([o-])[o-])cc(=o)[o-]
  • inchi-key:
    • okzycxhttzzysk-zcfiwibfsa-k
  • molecular-weight:
    • 225.115

Reaction(s) known to consume the compound

Reaction(s) known to produce the compound

Reaction(s) of unknown directionality

Retrieved from "https://gem-aureme.genouest.org/sjapgem/index.php?title=CPD-499&oldid=137558"