Difference between revisions of "CPD-499"
Jump to navigation
Jump to search
(Created page with "Category:metabolite == Metabolite 4-GUANIDO-BUTYRAMIDE == * common-name: ** 4-guanidinobutyramide * smiles: ** c(nc(n)=[n+])ccc(=o)n * inchi-key: ** yhvfecvvgnxfko-uhfffao...") |
(Created page with "Category:metabolite == Metabolite CPD-499 == * common-name: ** (r)-mevalonate 5-phosphate * smiles: ** cc(o)(ccop(=o)([o-])[o-])cc(=o)[o-] * inchi-key: ** okzycxhttzzysk-z...") |
||
| (5 intermediate revisions by 3 users not shown) | |||
| Line 1: | Line 1: | ||
[[Category:metabolite]] | [[Category:metabolite]] | ||
| − | == Metabolite | + | == Metabolite CPD-499 == |
* common-name: | * common-name: | ||
| − | ** | + | ** (r)-mevalonate 5-phosphate |
* smiles: | * smiles: | ||
| − | ** | + | ** cc(o)(ccop(=o)([o-])[o-])cc(=o)[o-] |
* inchi-key: | * inchi-key: | ||
| − | ** | + | ** okzycxhttzzysk-zcfiwibfsa-k |
* molecular-weight: | * molecular-weight: | ||
| − | ** | + | ** 225.115 |
== Reaction(s) known to consume the compound == | == Reaction(s) known to consume the compound == | ||
| − | * [[ | + | * [[MEVALONATE-KINASE-RXN]] |
| + | * [[PHOSPHOMEVALONATE-KINASE-RXN]] | ||
== Reaction(s) known to produce the compound == | == Reaction(s) known to produce the compound == | ||
| + | * [[MEVALONATE-KINASE-RXN]] | ||
| + | * [[PHOSPHOMEVALONATE-KINASE-RXN]] | ||
== Reaction(s) of unknown directionality == | == Reaction(s) of unknown directionality == | ||
| − | {{#set: common-name= | + | {{#set: common-name=(r)-mevalonate 5-phosphate}} |
| − | {{#set: inchi-key=inchikey= | + | {{#set: inchi-key=inchikey=okzycxhttzzysk-zcfiwibfsa-k}} |
| − | {{#set: molecular-weight= | + | {{#set: molecular-weight=225.115}} |
Latest revision as of 11:13, 18 March 2021
Contents
Metabolite CPD-499
- common-name:
- (r)-mevalonate 5-phosphate
- smiles:
- cc(o)(ccop(=o)([o-])[o-])cc(=o)[o-]
- inchi-key:
- okzycxhttzzysk-zcfiwibfsa-k
- molecular-weight:
- 225.115
