Difference between revisions of "CPD-499"

From metabolic_network
Jump to navigation Jump to search
(Created page with "Category:metabolite == Metabolite CPD1F-130 == * common-name: ** zeaxanthin * smiles: ** cc(c=cc=c(c=cc1(c(c)(c)cc(cc=1c)o))c)=cc=cc=c(c=cc=c(c=cc2(=c(cc(cc(c)(c)2)o)c))c)...")
(Created page with "Category:metabolite == Metabolite CPD-499 == * common-name: ** (r)-mevalonate 5-phosphate * smiles: ** cc(o)(ccop(=o)([o-])[o-])cc(=o)[o-] * inchi-key: ** okzycxhttzzysk-z...")
 
(4 intermediate revisions by 3 users not shown)
Line 1: Line 1:
 
[[Category:metabolite]]
 
[[Category:metabolite]]
== Metabolite CPD1F-130 ==
+
== Metabolite CPD-499 ==
 
* common-name:
 
* common-name:
** zeaxanthin
+
** (r)-mevalonate 5-phosphate
 
* smiles:
 
* smiles:
** cc(c=cc=c(c=cc1(c(c)(c)cc(cc=1c)o))c)=cc=cc=c(c=cc=c(c=cc2(=c(cc(cc(c)(c)2)o)c))c)c
+
** cc(o)(ccop(=o)([o-])[o-])cc(=o)[o-]
 
* inchi-key:
 
* inchi-key:
** jkqxzkusfckogq-qaybqhtqsa-n
+
** okzycxhttzzysk-zcfiwibfsa-k
 
* molecular-weight:
 
* molecular-weight:
** 568.881
+
** 225.115
 
== Reaction(s) known to consume the compound ==
 
== Reaction(s) known to consume the compound ==
* [[RXN-13185]]
+
* [[MEVALONATE-KINASE-RXN]]
* [[RXN-7978]]
+
* [[PHOSPHOMEVALONATE-KINASE-RXN]]
 
== Reaction(s) known to produce the compound ==
 
== Reaction(s) known to produce the compound ==
* [[RXN-13185]]
+
* [[MEVALONATE-KINASE-RXN]]
* [[RXN-7985]]
+
* [[PHOSPHOMEVALONATE-KINASE-RXN]]
* [[RXN-8026]]
 
* [[RXN1F-152]]
 
 
== Reaction(s) of unknown directionality ==
 
== Reaction(s) of unknown directionality ==
{{#set: common-name=zeaxanthin}}
+
{{#set: common-name=(r)-mevalonate 5-phosphate}}
{{#set: inchi-key=inchikey=jkqxzkusfckogq-qaybqhtqsa-n}}
+
{{#set: inchi-key=inchikey=okzycxhttzzysk-zcfiwibfsa-k}}
{{#set: molecular-weight=568.881}}
+
{{#set: molecular-weight=225.115}}

Latest revision as of 11:13, 18 March 2021

Metabolite CPD-499

  • common-name:
    • (r)-mevalonate 5-phosphate
  • smiles:
    • cc(o)(ccop(=o)([o-])[o-])cc(=o)[o-]
  • inchi-key:
    • okzycxhttzzysk-zcfiwibfsa-k
  • molecular-weight:
    • 225.115

Reaction(s) known to consume the compound

Reaction(s) known to produce the compound

Reaction(s) of unknown directionality