Difference between revisions of "CPD-499"
Jump to navigation
Jump to search
(Created page with "Category:gene == Gene SJ19102 == * transcription-direction: ** negative * right-end-position: ** 396753 * left-end-position: ** 392811 * centisome-position: ** 34.43243...") |
(Created page with "Category:metabolite == Metabolite CPD-499 == * common-name: ** (r)-mevalonate 5-phosphate * smiles: ** cc(o)(ccop(=o)([o-])[o-])cc(=o)[o-] * inchi-key: ** okzycxhttzzysk-z...") |
||
| (9 intermediate revisions by 5 users not shown) | |||
| Line 1: | Line 1: | ||
| − | [[Category: | + | [[Category:metabolite]] |
| − | == | + | == Metabolite CPD-499 == |
| − | * | + | * common-name: |
| − | ** | + | ** (r)-mevalonate 5-phosphate |
| − | * | + | * smiles: |
| − | ** | + | ** cc(o)(ccop(=o)([o-])[o-])cc(=o)[o-] |
| − | * | + | * inchi-key: |
| − | ** | + | ** okzycxhttzzysk-zcfiwibfsa-k |
| − | * | + | * molecular-weight: |
| − | ** | + | ** 225.115 |
| − | == | + | == Reaction(s) known to consume the compound == |
| − | * [[ | + | * [[MEVALONATE-KINASE-RXN]] |
| − | == Reaction(s) | + | * [[PHOSPHOMEVALONATE-KINASE-RXN]] |
| − | * [[RXN | + | == Reaction(s) known to produce the compound == |
| − | * | + | * [[MEVALONATE-KINASE-RXN]] |
| − | + | * [[PHOSPHOMEVALONATE-KINASE-RXN]] | |
| − | + | == Reaction(s) of unknown directionality == | |
| − | + | {{#set: common-name=(r)-mevalonate 5-phosphate}} | |
| − | + | {{#set: inchi-key=inchikey=okzycxhttzzysk-zcfiwibfsa-k}} | |
| − | + | {{#set: molecular-weight=225.115}} | |
| − | |||
| − | |||
| − | {{#set: | ||
| − | {{#set: | ||
| − | |||
| − | {{#set: | ||
| − | |||
| − | |||
Latest revision as of 11:13, 18 March 2021
Contents
Metabolite CPD-499
- common-name:
- (r)-mevalonate 5-phosphate
- smiles:
- cc(o)(ccop(=o)([o-])[o-])cc(=o)[o-]
- inchi-key:
- okzycxhttzzysk-zcfiwibfsa-k
- molecular-weight:
- 225.115
