Difference between revisions of "CPD-504"
Jump to navigation
Jump to search
(Created page with "Category:metabolite == Metabolite CPD-12014 == * common-name: ** 6-hydroxymelatonin * smiles: ** cc(=o)nccc1(=cnc2(c1=cc(oc)=c(o)c=2)) * inchi-key: ** omymrcxojjzyke-uhfff...") |
(Created page with "Category:metabolite == Metabolite CPD-504 == * common-name: ** a 1-monoglyceride == Reaction(s) known to consume the compound == * 3.1.1.23-RXN == Reaction(s) known to...") |
||
Line 1: | Line 1: | ||
[[Category:metabolite]] | [[Category:metabolite]] | ||
− | == Metabolite CPD- | + | == Metabolite CPD-504 == |
* common-name: | * common-name: | ||
− | ** | + | ** a 1-monoglyceride |
− | |||
− | |||
− | |||
− | |||
− | |||
− | |||
== Reaction(s) known to consume the compound == | == Reaction(s) known to consume the compound == | ||
− | * [[RXN | + | * [[3.1.1.23-RXN]] |
== Reaction(s) known to produce the compound == | == Reaction(s) known to produce the compound == | ||
− | |||
== Reaction(s) of unknown directionality == | == Reaction(s) of unknown directionality == | ||
− | {{#set: common-name= | + | {{#set: common-name=a 1-monoglyceride}} |
− | |||
− |
Latest revision as of 11:12, 18 March 2021
Contents
Metabolite CPD-504
- common-name:
- a 1-monoglyceride