Difference between revisions of "CPD-504"

From metabolic_network
Jump to navigation Jump to search
(Created page with "Category:metabolite == Metabolite PELARGONIDIN-3-GLUCOSIDE-CMPD == * common-name: ** pelargonidin-3-o-β-d-glucoside * smiles: ** c(o)c1(c(o)c(o)c(o)c(o1)oc3(=cc4(=c([...")
(Created page with "Category:metabolite == Metabolite CPD-504 == * common-name: ** a 1-monoglyceride == Reaction(s) known to consume the compound == * 3.1.1.23-RXN == Reaction(s) known to...")
 
(5 intermediate revisions by 2 users not shown)
Line 1: Line 1:
 
[[Category:metabolite]]
 
[[Category:metabolite]]
== Metabolite PELARGONIDIN-3-GLUCOSIDE-CMPD ==
+
== Metabolite CPD-504 ==
 
* common-name:
 
* common-name:
** pelargonidin-3-o-β-d-glucoside
+
** a 1-monoglyceride
* smiles:
 
** c(o)c1(c(o)c(o)c(o)c(o1)oc3(=cc4(=c([o+]=c(c2(=cc=c(o)c=c2))3)c=c(c=c([o-])4)[o-])))
 
* inchi-key:
 
** abvcubuixwjyse-gqupqbgvsa-m
 
* molecular-weight:
 
** 431.375
 
 
== Reaction(s) known to consume the compound ==
 
== Reaction(s) known to consume the compound ==
* [[RXN-7828]]
+
* [[3.1.1.23-RXN]]
 
== Reaction(s) known to produce the compound ==
 
== Reaction(s) known to produce the compound ==
 
== Reaction(s) of unknown directionality ==
 
== Reaction(s) of unknown directionality ==
{{#set: common-name=pelargonidin-3-o-β-d-glucoside}}
+
{{#set: common-name=a 1-monoglyceride}}
{{#set: inchi-key=inchikey=abvcubuixwjyse-gqupqbgvsa-m}}
 
{{#set: molecular-weight=431.375}}
 

Latest revision as of 11:12, 18 March 2021

Metabolite CPD-504

  • common-name:
    • a 1-monoglyceride

Reaction(s) known to consume the compound

Reaction(s) known to produce the compound

Reaction(s) of unknown directionality