Difference between revisions of "CPD-504"

From metabolic_network
Jump to navigation Jump to search
(Created page with "Category:metabolite == Metabolite PELARGONIDIN-3-GLUCOSIDE-CMPD == * common-name: ** pelargonidin-3-o-β-d-glucoside * smiles: ** c(o)c1(c(o)c(o)c(o)c(o1)oc3(=cc4(=c([...")
(Created page with "Category:metabolite == Metabolite 11Z-icos-11-enoyl-ACPs == * common-name: ** a gondoyl-[acp] == Reaction(s) known to consume the compound == == Reaction(s) known to produ...")
Line 1: Line 1:
 
[[Category:metabolite]]
 
[[Category:metabolite]]
== Metabolite PELARGONIDIN-3-GLUCOSIDE-CMPD ==
+
== Metabolite 11Z-icos-11-enoyl-ACPs ==
 
* common-name:
 
* common-name:
** pelargonidin-3-o-β-d-glucoside
+
** a gondoyl-[acp]
* smiles:
 
** c(o)c1(c(o)c(o)c(o)c(o1)oc3(=cc4(=c([o+]=c(c2(=cc=c(o)c=c2))3)c=c(c=c([o-])4)[o-])))
 
* inchi-key:
 
** abvcubuixwjyse-gqupqbgvsa-m
 
* molecular-weight:
 
** 431.375
 
 
== Reaction(s) known to consume the compound ==
 
== Reaction(s) known to consume the compound ==
* [[RXN-7828]]
 
 
== Reaction(s) known to produce the compound ==
 
== Reaction(s) known to produce the compound ==
 +
* [[RXN-16632]]
 
== Reaction(s) of unknown directionality ==
 
== Reaction(s) of unknown directionality ==
{{#set: common-name=pelargonidin-3-o-β-d-glucoside}}
+
{{#set: common-name=a gondoyl-[acp]}}
{{#set: inchi-key=inchikey=abvcubuixwjyse-gqupqbgvsa-m}}
 
{{#set: molecular-weight=431.375}}
 

Revision as of 15:25, 5 January 2021

Metabolite 11Z-icos-11-enoyl-ACPs

  • common-name:
    • a gondoyl-[acp]

Reaction(s) known to consume the compound

Reaction(s) known to produce the compound

Reaction(s) of unknown directionality

Property "Common-name" (as page type) with input value "a gondoyl-[acp" contains invalid characters or is incomplete and therefore can cause unexpected results during a query or annotation process.