Difference between revisions of "CPD-510"

From metabolic_network
Jump to navigation Jump to search
(Created page with "Category:metabolite == Metabolite CPD-506 == * common-name: ** d-myo-inositol (1,3,4,5)-tetrakisphosphate * smiles: ** c1(o)(c(op([o-])(=o)[o-])c(op(=o)([o-])[o-])c(op(=o)...")
(Created page with "Category:metabolite == Metabolite CPD-510 == * common-name: ** α-d-glucuronate 1-phosphate * smiles: ** c(c1(oc(c(c(c1o)o)o)op([o-])([o-])=o))([o-])=o * inchi-key: *...")
 
Line 1: Line 1:
 
[[Category:metabolite]]
 
[[Category:metabolite]]
== Metabolite CPD-506 ==
+
== Metabolite CPD-510 ==
 
* common-name:
 
* common-name:
** d-myo-inositol (1,3,4,5)-tetrakisphosphate
+
** α-d-glucuronate 1-phosphate
 
* smiles:
 
* smiles:
** c1(o)(c(op([o-])(=o)[o-])c(op(=o)([o-])[o-])c(op(=o)([o-])[o-])c(o)c(op([o-])([o-])=o)1)
+
** c(c1(oc(c(c(c1o)o)o)op([o-])([o-])=o))([o-])=o
 
* inchi-key:
 
* inchi-key:
** cipfcgzlfxvxbg-cnwjwelysa-f
+
** aiqdykmwenwvqj-qiuujyrfsa-k
 
* molecular-weight:
 
* molecular-weight:
** 492.013
+
** 271.097
 
== Reaction(s) known to consume the compound ==
 
== Reaction(s) known to consume the compound ==
* [[RXN-7184]]
+
* [[2.7.7.44-RXN]]
* [[RXN-8730]]
 
 
== Reaction(s) known to produce the compound ==
 
== Reaction(s) known to produce the compound ==
* [[2.7.1.127-RXN]]
+
* [[2.7.7.44-RXN]]
* [[2.7.1.139-RXN]]
 
 
== Reaction(s) of unknown directionality ==
 
== Reaction(s) of unknown directionality ==
{{#set: common-name=d-myo-inositol (1,3,4,5)-tetrakisphosphate}}
+
{{#set: common-name=α-d-glucuronate 1-phosphate}}
{{#set: inchi-key=inchikey=cipfcgzlfxvxbg-cnwjwelysa-f}}
+
{{#set: inchi-key=inchikey=aiqdykmwenwvqj-qiuujyrfsa-k}}
{{#set: molecular-weight=492.013}}
+
{{#set: molecular-weight=271.097}}

Latest revision as of 11:12, 18 March 2021

Metabolite CPD-510

  • common-name:
    • α-d-glucuronate 1-phosphate
  • smiles:
    • c(c1(oc(c(c(c1o)o)o)op([o-])([o-])=o))([o-])=o
  • inchi-key:
    • aiqdykmwenwvqj-qiuujyrfsa-k
  • molecular-weight:
    • 271.097

Reaction(s) known to consume the compound

Reaction(s) known to produce the compound

Reaction(s) of unknown directionality