Difference between revisions of "CPD-511"
Jump to navigation
Jump to search
(Created page with "Category:metabolite == Metabolite CPD-2752 == * common-name: ** trans-3-hydroxycotinine-glucuronide * smiles: ** c2(=o)(c(oc1(c(c(c(c(o1)c([o-])=o)o)o)o))c[ch](n(c)2)c3(=c...") |
(Created page with "Category:metabolite == Metabolite CPD-511 == * common-name: ** pantetheine * smiles: ** cc(c(o)c(=o)nccc(nccs)=o)(c)co * inchi-key: ** znxzgrmvnnhpca-vifpvbqesa-n * molecu...") |
||
| (One intermediate revision by one other user not shown) | |||
| Line 1: | Line 1: | ||
[[Category:metabolite]] | [[Category:metabolite]] | ||
| − | == Metabolite CPD- | + | == Metabolite CPD-511 == |
* common-name: | * common-name: | ||
| − | ** | + | ** pantetheine |
* smiles: | * smiles: | ||
| − | ** | + | ** cc(c(o)c(=o)nccc(nccs)=o)(c)co |
* inchi-key: | * inchi-key: | ||
| − | ** | + | ** znxzgrmvnnhpca-vifpvbqesa-n |
* molecular-weight: | * molecular-weight: | ||
| − | ** | + | ** 278.366 |
== Reaction(s) known to consume the compound == | == Reaction(s) known to consume the compound == | ||
| + | * [[PANTETHEINE-KINASE-RXN]] | ||
== Reaction(s) known to produce the compound == | == Reaction(s) known to produce the compound == | ||
| − | * [[ | + | * [[PANTETHEINE-KINASE-RXN]] |
== Reaction(s) of unknown directionality == | == Reaction(s) of unknown directionality == | ||
| − | {{#set: common-name= | + | {{#set: common-name=pantetheine}} |
| − | {{#set: inchi-key=inchikey= | + | {{#set: inchi-key=inchikey=znxzgrmvnnhpca-vifpvbqesa-n}} |
| − | {{#set: molecular-weight= | + | {{#set: molecular-weight=278.366}} |
Latest revision as of 11:13, 18 March 2021
Contents
Metabolite CPD-511
- common-name:
- pantetheine
- smiles:
- cc(c(o)c(=o)nccc(nccs)=o)(c)co
- inchi-key:
- znxzgrmvnnhpca-vifpvbqesa-n
- molecular-weight:
- 278.366
