Difference between revisions of "CPD-511"
Jump to navigation
Jump to search
(Created page with "Category:gene == Gene SJ18164 == * transcription-direction: ** negative * right-end-position: ** 550353 * left-end-position: ** 544940 * centisome-position: ** 83.8346...") |
(Created page with "Category:metabolite == Metabolite CPD-511 == * common-name: ** pantetheine * smiles: ** cc(c(o)c(=o)nccc(nccs)=o)(c)co * inchi-key: ** znxzgrmvnnhpca-vifpvbqesa-n * molecu...") |
||
| (9 intermediate revisions by 5 users not shown) | |||
| Line 1: | Line 1: | ||
| − | [[Category: | + | [[Category:metabolite]] |
| − | == | + | == Metabolite CPD-511 == |
| − | * | + | * common-name: |
| − | ** | + | ** pantetheine |
| − | * | + | * smiles: |
| − | ** | + | ** cc(c(o)c(=o)nccc(nccs)=o)(c)co |
| − | * | + | * inchi-key: |
| − | ** | + | ** znxzgrmvnnhpca-vifpvbqesa-n |
| − | * | + | * molecular-weight: |
| − | ** | + | ** 278.366 |
| − | == | + | == Reaction(s) known to consume the compound == |
| − | * [[ | + | * [[PANTETHEINE-KINASE-RXN]] |
| − | == Reaction(s) | + | == Reaction(s) known to produce the compound == |
| − | * [[ | + | * [[PANTETHEINE-KINASE-RXN]] |
| − | + | == Reaction(s) of unknown directionality == | |
| − | + | {{#set: common-name=pantetheine}} | |
| − | + | {{#set: inchi-key=inchikey=znxzgrmvnnhpca-vifpvbqesa-n}} | |
| − | + | {{#set: molecular-weight=278.366}} | |
| − | |||
| − | |||
| − | |||
| − | {{#set: | ||
| − | {{#set: | ||
| − | |||
| − | {{#set: | ||
| − | |||
| − | |||
Latest revision as of 11:13, 18 March 2021
Contents
Metabolite CPD-511
- common-name:
- pantetheine
- smiles:
- cc(c(o)c(=o)nccc(nccs)=o)(c)co
- inchi-key:
- znxzgrmvnnhpca-vifpvbqesa-n
- molecular-weight:
- 278.366
