Difference between revisions of "CPD-514"

From metabolic_network
Jump to navigation Jump to search
(Created page with "Category:metabolite == Metabolite CPD-479 == * common-name: ** 4-(methylsulfanyl)-2-oxobutanoate * smiles: ** csccc(c([o-])=o)=o * inchi-key: ** sxfsqzdsuwackx-uhfffaoysa-...")
(Created page with "Category:metabolite == Metabolite CPD-514 == * common-name: ** 3-oxo-3-phenylpropanoyl-coa * smiles: ** cc(c)(c(o)c(=o)nccc(=o)nccsc(=o)cc(=o)c1(=cc=cc=c1))cop(=o)(op(=o)(...")
 
(6 intermediate revisions by 2 users not shown)
Line 1: Line 1:
 
[[Category:metabolite]]
 
[[Category:metabolite]]
== Metabolite CPD-479 ==
+
== Metabolite CPD-514 ==
 
* common-name:
 
* common-name:
** 4-(methylsulfanyl)-2-oxobutanoate
+
** 3-oxo-3-phenylpropanoyl-coa
 
* smiles:
 
* smiles:
** csccc(c([o-])=o)=o
+
** cc(c)(c(o)c(=o)nccc(=o)nccsc(=o)cc(=o)c1(=cc=cc=c1))cop(=o)(op(=o)(occ2(c(op([o-])(=o)[o-])c(o)c(o2)n4(c3(=c(c(n)=nc=n3)n=c4))))[o-])[o-]
 
* inchi-key:
 
* inchi-key:
** sxfsqzdsuwackx-uhfffaoysa-m
+
** nhdpiyiccbknnj-fueukbnzsa-j
 
* molecular-weight:
 
* molecular-weight:
** 147.168
+
** 909.648
 
== Reaction(s) known to consume the compound ==
 
== Reaction(s) known to consume the compound ==
* [[RXN-14147]]
+
* [[RXN-2006]]
 
== Reaction(s) known to produce the compound ==
 
== Reaction(s) known to produce the compound ==
* [[R147-RXN]]
 
* [[RXN-14147]]
 
 
== Reaction(s) of unknown directionality ==
 
== Reaction(s) of unknown directionality ==
{{#set: common-name=4-(methylsulfanyl)-2-oxobutanoate}}
+
{{#set: common-name=3-oxo-3-phenylpropanoyl-coa}}
{{#set: inchi-key=inchikey=sxfsqzdsuwackx-uhfffaoysa-m}}
+
{{#set: inchi-key=inchikey=nhdpiyiccbknnj-fueukbnzsa-j}}
{{#set: molecular-weight=147.168}}
+
{{#set: molecular-weight=909.648}}

Latest revision as of 11:11, 18 March 2021

Metabolite CPD-514

  • common-name:
    • 3-oxo-3-phenylpropanoyl-coa
  • smiles:
    • cc(c)(c(o)c(=o)nccc(=o)nccsc(=o)cc(=o)c1(=cc=cc=c1))cop(=o)(op(=o)(occ2(c(op([o-])(=o)[o-])c(o)c(o2)n4(c3(=c(c(n)=nc=n3)n=c4))))[o-])[o-]
  • inchi-key:
    • nhdpiyiccbknnj-fueukbnzsa-j
  • molecular-weight:
    • 909.648

Reaction(s) known to consume the compound

Reaction(s) known to produce the compound

Reaction(s) of unknown directionality