Difference between revisions of "CPD-5161"
Jump to navigation
Jump to search
(Created page with "Category:metabolite == Metabolite SCOPOLETIN == * common-name: ** scopoletin * smiles: ** coc2(c=c1(c(oc(=o)c=c1)=cc=2o)) * inchi-key: ** rodxrvnmmdrfik-uhfffaoysa-n * mol...") |
(Created page with "Category:metabolite == Metabolite Beta-D-glucan-w-C-3-substitution == * common-name: ** a β-d-glucan with a c3-substituted glucose == Reaction(s) known to consume the...") |
||
| Line 1: | Line 1: | ||
[[Category:metabolite]] | [[Category:metabolite]] | ||
| − | == Metabolite | + | == Metabolite Beta-D-glucan-w-C-3-substitution == |
* common-name: | * common-name: | ||
| − | ** | + | ** a β-d-glucan with a c3-substituted glucose |
| − | |||
| − | |||
| − | |||
| − | |||
| − | |||
| − | |||
== Reaction(s) known to consume the compound == | == Reaction(s) known to consume the compound == | ||
| + | * [[3.2.1.6-RXN]] | ||
== Reaction(s) known to produce the compound == | == Reaction(s) known to produce the compound == | ||
| − | |||
== Reaction(s) of unknown directionality == | == Reaction(s) of unknown directionality == | ||
| − | {{#set: common-name= | + | {{#set: common-name=a β-d-glucan with a c3-substituted glucose}} |
| − | |||
| − | |||
Revision as of 18:52, 14 January 2021
Contents
Metabolite Beta-D-glucan-w-C-3-substitution
- common-name:
- a β-d-glucan with a c3-substituted glucose
