Difference between revisions of "CPD-5162"
Jump to navigation
Jump to search
(Created page with "Category:metabolite == Metabolite CPD-510 == * common-name: ** α-d-glucuronate 1-phosphate * smiles: ** c(c1(oc(c(c(c1o)o)o)op([o-])([o-])=o))([o-])=o * inchi-key: *...") |
(Created page with "Category:metabolite == Metabolite CPD-5162 == * common-name: ** α-d-man-(1→3)-[α-d-man-(1→6)]-α-d-man-(1→4)-β-d-glcnac-(1→4)-&al...") |
||
| (6 intermediate revisions by 3 users not shown) | |||
| Line 1: | Line 1: | ||
[[Category:metabolite]] | [[Category:metabolite]] | ||
| − | == Metabolite CPD- | + | == Metabolite CPD-5162 == |
* common-name: | * common-name: | ||
| − | ** α-d- | + | ** α-d-man-(1→3)-[α-d-man-(1→6)]-α-d-man-(1→4)-β-d-glcnac-(1→4)-α-d-glcnac-diphosphodolichol |
| − | |||
| − | |||
| − | |||
| − | |||
| − | |||
| − | |||
== Reaction(s) known to consume the compound == | == Reaction(s) known to consume the compound == | ||
| − | * [[ | + | * [[RXN-5464]] |
== Reaction(s) known to produce the compound == | == Reaction(s) known to produce the compound == | ||
| − | * [[ | + | * [[RXN-5463]] |
== Reaction(s) of unknown directionality == | == Reaction(s) of unknown directionality == | ||
| − | {{#set: common-name=α-d- | + | {{#set: common-name=α-d-man-(1→3)-[α-d-man-(1→6)]-α-d-man-(1→4)-β-d-glcnac-(1→4)-α-d-glcnac-diphosphodolichol}} |
| − | |||
| − | |||
Latest revision as of 11:12, 18 March 2021
Contents
Metabolite CPD-5162
- common-name:
- α-d-man-(1→3)-[α-d-man-(1→6)]-α-d-man-(1→4)-β-d-glcnac-(1→4)-α-d-glcnac-diphosphodolichol
Reaction(s) known to consume the compound
Reaction(s) known to produce the compound
Reaction(s) of unknown directionality
Property "Common-name" (as page type) with input value "α-d-man-(1→3)-[α-d-man-(1→6)]-α-d-man-(1→4)-β-d-glcnac-(1→4)-α-d-glcnac-diphosphodolichol" contains invalid characters or is incomplete and therefore can cause unexpected results during a query or annotation process.
