Difference between revisions of "CPD-5162"
Jump to navigation
Jump to search
(Created page with "Category:metabolite == Metabolite CPD-510 == * common-name: ** α-d-glucuronate 1-phosphate * smiles: ** c(c1(oc(c(c(c1o)o)o)op([o-])([o-])=o))([o-])=o * inchi-key: *...") |
(Created page with "Category:metabolite == Metabolite CPD-14268 == * common-name: ** (15z)-tetracosenoate * smiles: ** ccccccccc=ccccccccccccccc(=o)[o-] * inchi-key: ** gwhcxvqvjpwhrf-ktkrtig...") |
||
| Line 1: | Line 1: | ||
[[Category:metabolite]] | [[Category:metabolite]] | ||
| − | == Metabolite CPD- | + | == Metabolite CPD-14268 == |
* common-name: | * common-name: | ||
| − | ** | + | ** (15z)-tetracosenoate |
* smiles: | * smiles: | ||
| − | ** | + | ** ccccccccc=ccccccccccccccc(=o)[o-] |
* inchi-key: | * inchi-key: | ||
| − | ** | + | ** gwhcxvqvjpwhrf-ktkrtigzsa-m |
* molecular-weight: | * molecular-weight: | ||
| − | ** | + | ** 365.618 |
== Reaction(s) known to consume the compound == | == Reaction(s) known to consume the compound == | ||
| − | * [[ | + | * [[RXN-13290]] |
== Reaction(s) known to produce the compound == | == Reaction(s) known to produce the compound == | ||
| − | |||
== Reaction(s) of unknown directionality == | == Reaction(s) of unknown directionality == | ||
| − | {{#set: common-name= | + | {{#set: common-name=(15z)-tetracosenoate}} |
| − | {{#set: inchi-key=inchikey= | + | {{#set: inchi-key=inchikey=gwhcxvqvjpwhrf-ktkrtigzsa-m}} |
| − | {{#set: molecular-weight= | + | {{#set: molecular-weight=365.618}} |
Revision as of 14:55, 5 January 2021
Contents
Metabolite CPD-14268
- common-name:
- (15z)-tetracosenoate
- smiles:
- ccccccccc=ccccccccccccccc(=o)[o-]
- inchi-key:
- gwhcxvqvjpwhrf-ktkrtigzsa-m
- molecular-weight:
- 365.618
