Difference between revisions of "CPD-5167"
Jump to navigation
Jump to search
(Created page with "Category:metabolite == Metabolite Oxidized-flavodoxins == * common-name: ** an oxidized flavodoxin == Reaction(s) known to consume the compound == * [[FLAVONADPREDUCT-RXN]...") |
(Created page with "Category:metabolite == Metabolite CPD-7280 == * common-name: ** (3s,5r,6s)-5,6-epoxy-3-hydroxy-5,6-dihydro-12'-apo-β-caroten-12'-al * smiles: ** cc(c=cc=c(c)c=cc12(oc...") |
||
| Line 1: | Line 1: | ||
[[Category:metabolite]] | [[Category:metabolite]] | ||
| − | == Metabolite | + | == Metabolite CPD-7280 == |
* common-name: | * common-name: | ||
| − | ** | + | ** (3s,5r,6s)-5,6-epoxy-3-hydroxy-5,6-dihydro-12'-apo-β-caroten-12'-al |
| + | * smiles: | ||
| + | ** cc(c=cc=c(c)c=cc12(oc(cc(o)cc(c)(c)1)2))=cc=cc=c(c)cc=o | ||
| + | * inchi-key: | ||
| + | ** fyydcjdefsyvoy-wenurhbksa-n | ||
| + | * molecular-weight: | ||
| + | ** 382.542 | ||
== Reaction(s) known to consume the compound == | == Reaction(s) known to consume the compound == | ||
| − | |||
| − | |||
== Reaction(s) known to produce the compound == | == Reaction(s) known to produce the compound == | ||
| − | * [[ | + | * [[RXN-7973-CPD-7424/OXYGEN-MOLECULE//CPD-7279/CPD-7280.44.]] |
| − | |||
| − | |||
== Reaction(s) of unknown directionality == | == Reaction(s) of unknown directionality == | ||
| − | {{#set: common-name= | + | {{#set: common-name=(3s,5r,6s)-5,6-epoxy-3-hydroxy-5,6-dihydro-12'-apo-β-caroten-12'-al}} |
| + | {{#set: inchi-key=inchikey=fyydcjdefsyvoy-wenurhbksa-n}} | ||
| + | {{#set: molecular-weight=382.542}} | ||
Revision as of 08:25, 15 March 2021
Contents
Metabolite CPD-7280
- common-name:
- (3s,5r,6s)-5,6-epoxy-3-hydroxy-5,6-dihydro-12'-apo-β-caroten-12'-al
- smiles:
- cc(c=cc=c(c)c=cc12(oc(cc(o)cc(c)(c)1)2))=cc=cc=c(c)cc=o
- inchi-key:
- fyydcjdefsyvoy-wenurhbksa-n
- molecular-weight:
- 382.542
