Difference between revisions of "CPD-5167"

From metabolic_network
Jump to navigation Jump to search
(Created page with "Category:metabolite == Metabolite CPD-17375 == * common-name: ** 1-[18-hydroxyoeoyl]-2-[18-hydroxy-lioleoyl]-sn-glycerol * smiles: ** c(o)cccccccc=ccccccccc(occ(oc(=o)cccc...")
(Created page with "Category:metabolite == Metabolite PHYTOSPINGOSINE == * common-name: ** phytosphingosine * smiles: ** ccccccccccccccc(o)c(c(co)[n+])o * inchi-key: ** aerbncycjbrydg-kszliro...")
Line 1: Line 1:
 
[[Category:metabolite]]
 
[[Category:metabolite]]
== Metabolite CPD-17375 ==
+
== Metabolite PHYTOSPINGOSINE ==
 
* common-name:
 
* common-name:
** 1-[18-hydroxyoeoyl]-2-[18-hydroxy-lioleoyl]-sn-glycerol
+
** phytosphingosine
 
* smiles:
 
* smiles:
** c(o)cccccccc=ccccccccc(occ(oc(=o)cccccccc=ccc=cccccco)co)=o
+
** ccccccccccccccc(o)c(c(co)[n+])o
 
* inchi-key:
 
* inchi-key:
** rcalbbvhqnuwno-osfdyrcisa-n
+
** aerbncycjbrydg-kszliroesa-o
 
* molecular-weight:
 
* molecular-weight:
** 650.978
+
** 318.519
 
== Reaction(s) known to consume the compound ==
 
== Reaction(s) known to consume the compound ==
 +
* [[RXN3O-328]]
 +
* [[RXN3O-458]]
 
== Reaction(s) known to produce the compound ==
 
== Reaction(s) known to produce the compound ==
* [[RXN-16121]]
 
 
== Reaction(s) of unknown directionality ==
 
== Reaction(s) of unknown directionality ==
{{#set: common-name=1-[18-hydroxyoeoyl]-2-[18-hydroxy-lioleoyl]-sn-glycerol}}
+
{{#set: common-name=phytosphingosine}}
{{#set: inchi-key=inchikey=rcalbbvhqnuwno-osfdyrcisa-n}}
+
{{#set: inchi-key=inchikey=aerbncycjbrydg-kszliroesa-o}}
{{#set: molecular-weight=650.978}}
+
{{#set: molecular-weight=318.519}}

Revision as of 18:53, 14 January 2021

Metabolite PHYTOSPINGOSINE

  • common-name:
    • phytosphingosine
  • smiles:
    • ccccccccccccccc(o)c(c(co)[n+])o
  • inchi-key:
    • aerbncycjbrydg-kszliroesa-o
  • molecular-weight:
    • 318.519

Reaction(s) known to consume the compound

Reaction(s) known to produce the compound

Reaction(s) of unknown directionality