Difference between revisions of "CPD-5169"

From metabolic_network
Jump to navigation Jump to search
(Created page with "Category:metabolite == Metabolite CPD-12129 == * common-name: ** menaquinol-12 * smiles: ** cc(=cccc(=cccc(=cccc(=cccc(c)=cccc(c)=cccc(c)=cccc(c)=cccc(c)=cccc(c)=cccc(c)=c...")
(Created page with "Category:metabolite == Metabolite CPD-15015 == * common-name: ** 4-hydroxy-2-oxoglutarate == Reaction(s) known to consume the compound == * 4OH2OXOGLUTARALDOL-RXN == R...")
Line 1: Line 1:
 
[[Category:metabolite]]
 
[[Category:metabolite]]
== Metabolite CPD-12129 ==
+
== Metabolite CPD-15015 ==
 
* common-name:
 
* common-name:
** menaquinol-12
+
** 4-hydroxy-2-oxoglutarate
* smiles:
 
** cc(=cccc(=cccc(=cccc(=cccc(c)=cccc(c)=cccc(c)=cccc(c)=cccc(c)=cccc(c)=cccc(c)=cccc(c)=ccc1(c(c)=c(o)c2(c=cc=cc(c(o)=1)=2)))c)c)c)c
 
* inchi-key:
 
** fwfjgqgpmzxtlm-wppieqshsa-n
 
* molecular-weight:
 
** 991.617
 
 
== Reaction(s) known to consume the compound ==
 
== Reaction(s) known to consume the compound ==
 +
* [[4OH2OXOGLUTARALDOL-RXN]]
 
== Reaction(s) known to produce the compound ==
 
== Reaction(s) known to produce the compound ==
* [[RXN-9363]]
+
* [[4OH2OXOGLUTARALDOL-RXN]]
 
== Reaction(s) of unknown directionality ==
 
== Reaction(s) of unknown directionality ==
{{#set: common-name=menaquinol-12}}
+
{{#set: common-name=4-hydroxy-2-oxoglutarate}}
{{#set: inchi-key=inchikey=fwfjgqgpmzxtlm-wppieqshsa-n}}
 
{{#set: molecular-weight=991.617}}
 

Revision as of 11:16, 15 January 2021

Metabolite CPD-15015

  • common-name:
    • 4-hydroxy-2-oxoglutarate

Reaction(s) known to consume the compound

Reaction(s) known to produce the compound

Reaction(s) of unknown directionality